(E)-methyl 2-(butoxycarbonylamino)-3-(3-(4-(N'-(2,2,2-trifluoroacetoxy)carbamimidoyl)benzyloxy)isoxazole-5-carboxamido)propanoate

ID: ALA5280420

Max Phase: Preclinical

Molecular Formula: C23H26F3N5O9

Molecular Weight: 573.48

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NC(CNC(=O)c1cc(OCc2ccc(/C(N)=N\OC(=O)C(F)(F)F)cc2)no1)C(=O)OC

Standard InChI:  InChI=1S/C23H26F3N5O9/c1-3-4-9-37-22(35)29-15(20(33)36-2)11-28-19(32)16-10-17(30-39-16)38-12-13-5-7-14(8-6-13)18(27)31-40-21(34)23(24,25)26/h5-8,10,15H,3-4,9,11-12H2,1-2H3,(H2,27,31)(H,28,32)(H,29,35)

Standard InChI Key:  AVRDMPDYEYGBPY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 41  0  0  0  0  0  0  0  0999 V2000
   -3.0725    2.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4848    3.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0729    3.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2477    3.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8359    3.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2440    2.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8314    1.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0062    1.6328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5936    0.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2314    0.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4816    0.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1719   -0.3567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8395    0.1353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2787   -0.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8622    0.4839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4923   -0.8965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2893   -1.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5029   -1.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3000   -2.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9194   -2.4907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8835   -1.5373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5136   -2.9178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3107   -3.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1330   -3.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5495   -3.8713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9300   -3.5013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7631   -4.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1796   -5.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3932   -6.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8097   -6.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4855    4.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3107    4.4885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2477    5.2032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0729    5.2032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8351    5.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0099    5.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2477    6.6324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5973    6.6324    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5973    5.2032    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1847    5.9178    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 10 11  2  0
 11 12  1  0
 13 12  1  0
  9 13  2  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 19 21  2  0
 19 22  1  0
 22 23  1  0
 20 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
  3 31  1  0
 31 32  1  0
 31 34  2  0
 34 33  1  0
 33 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  1  0
 36 39  1  0
 36 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280420

    ---

Associated Targets(non-human)

Canis familiaris (36305 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 573.48Molecular Weight (Monoisotopic): 573.1683AlogP: 1.78#Rotatable Bonds: 13
Polar Surface Area: 193.67Molecular Species: NEUTRALHBA: 11HBD: 3
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.02CX Basic pKa: 4.61CX LogP: 2.49CX LogD: 2.49
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.08Np Likeness Score: -0.98

References

1. Sysak A, Obmińska-Mrukowicz B..  (2017)  Isoxazole ring as a useful scaffold in a search for new therapeutic agents.,  137  [PMID:28605676] [10.1016/j.ejmech.2017.06.002]

Source