8-(sec-butyl)-6-methoxy-2-((1-(methylsulfonyl)piperidin-4-yl)amino)pteridin-7(8H)-one

ID: ALA5280432

Max Phase: Preclinical

Molecular Formula: C17H26N6O4S

Molecular Weight: 410.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(C)n1c(=O)c(OC)nc2cnc(NC3CCN(S(C)(=O)=O)CC3)nc21

Standard InChI:  InChI=1S/C17H26N6O4S/c1-5-11(2)23-14-13(20-15(27-3)16(23)24)10-18-17(21-14)19-12-6-8-22(9-7-12)28(4,25)26/h10-12H,5-9H2,1-4H3,(H,18,19,21)

Standard InChI Key:  FOEPNDXQVKNLGU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    0.3586    1.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0732    1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851    1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0750   -0.2054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3586    0.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4997   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4997    1.4440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4997   -1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3559   -0.2099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0705    0.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7852   -0.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4998    0.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4998    1.0278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7852    1.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0705    1.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2144    1.4403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9290    1.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8010    2.1563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6270    2.1563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290    1.4440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9290    2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144   -2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  3 10  1  0
  8 11  2  0
 12  7  1  0
  6 13  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 14 19  1  0
 17 20  1  0
 20 21  1  0
 20 22  2  0
 20 23  2  0
  9 24  1  0
 24 25  1  0
 12 26  1  0
 12 27  1  0
 26 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280432

    ---

Associated Targets(Human)

CCNE1 Tchem Cyclin-dependent kinase 2/cyclin E (1410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.50Molecular Weight (Monoisotopic): 410.1736AlogP: 1.00#Rotatable Bonds: 6
Polar Surface Area: 119.31Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.43CX LogP: -0.02CX LogD: -0.02
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: -1.52

References

1. Wang X, Ding L, Jiang H, Yuan X, Xiang L, Tang C..  (2023)  Synthesis and biological evaluation of novel pteridin-7(8H)-one derivatives as potent CDK2 inhibitors.,  88  [PMID:37060933] [10.1016/j.bmcl.2023.129284]

Source