6-(cyclopropanecarbonylamino)-4-[2-methoxy-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]anilino]-N-(trideuteriomethyl)pyridazine-3-carboxamide

ID: ALA5280466

Max Phase: Preclinical

Molecular Formula: C28H29N7O5

Molecular Weight: 543.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(C(=O)Nc2ccc(N3CCCC3=O)cc2)c1OC

Standard InChI:  InChI=1S/C28H29N7O5/c1-29-28(39)24-21(15-22(33-34-24)32-26(37)16-8-9-16)31-20-6-3-5-19(25(20)40-2)27(38)30-17-10-12-18(13-11-17)35-14-4-7-23(35)36/h3,5-6,10-13,15-16H,4,7-9,14H2,1-2H3,(H,29,39)(H,30,38)(H2,31,32,33,37)/i1D3

Standard InChI Key:  WEGCSLRPQNBQKH-FIBGUPNXSA-N

Molfile:  

 
     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
   -0.6654    1.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0491    1.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7610    1.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7610    0.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0508    0.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6654    0.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0491    2.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6655    3.0420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7637    3.0420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4783    2.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3801    1.8044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0947    1.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3801    0.1508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3801   -0.6743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1931    3.0418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9052    2.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9052    1.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1949    1.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4783    1.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6199    1.3917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0946   -1.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0939   -1.9098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3790   -2.3226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6671   -1.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6623   -1.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0474   -2.3260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7621   -1.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4767   -2.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7621   -1.0882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8900   -3.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3019   -2.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8092   -0.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5239   -1.0871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8092    0.1506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2386   -0.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9532   -1.0871    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2386    0.1506    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9532   -0.2620    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3344    1.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9532    1.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6226    0.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7984    0.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2149    0.0072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  1 11  1  0
 11 12  1  0
  6 13  1  0
 13 14  1  0
 15 10  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 10 19  1  0
 17 20  1  0
 21 14  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 14 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 30 28  1  0
 30 31  1  0
 28 31  1  0
 21 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
 39 20  1  0
 39 40  1  0
 40 41  1  0
 42 41  1  0
 20 42  1  0
 42 43  2  0
M  ISO  3  36   2  37   2  38   2
M  END

Associated Targets(Human)

TYK2 Tclin Tyrosine-protein kinase TYK2 (5029 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.58Molecular Weight (Monoisotopic): 543.2230AlogP: 3.32#Rotatable Bonds: 9
Polar Surface Area: 154.65Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.09CX Basic pKa: 3.35CX LogP: 2.85CX LogD: 2.85
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -1.48

References

1. Liu F, Wang B, Liu Y, Shi W, Hu Z, Chang X, Tang X, Zhang Y, Xu H, He Y..  (2023)  Design, synthesis and biological evaluation of novel N-(methyl-d3) pyridazine-3-carboxamide derivatives as TYK2 inhibitors.,  86  [PMID:36907336] [10.1016/j.bmcl.2023.129235]

Source