The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-hydroxy-3-(4-(((S)-7-hydroxy-6-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl)phenoxy)benzyl)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol ID: ALA5280570
Max Phase: Preclinical
Molecular Formula: C34H36N2O6
Molecular Weight: 568.67
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1O)C(Cc1ccc(O)c(Oc3ccc(C[C@@H]4NCCc5cc(OC)c(O)cc54)cc3)c1)NCC2
Standard InChI: InChI=1S/C34H36N2O6/c1-40-32-16-22-9-11-35-27(25(22)18-30(32)38)13-20-3-6-24(7-4-20)42-34-15-21(5-8-29(34)37)14-28-26-19-31(39)33(41-2)17-23(26)10-12-36-28/h3-8,15-19,27-28,35-39H,9-14H2,1-2H3/t27-,28?/m0/s1
Standard InChI Key: DUBVXSGAOWUPMY-MBMZGMDYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
-4.2855 -1.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5710 -0.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8591 -1.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8591 -2.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5692 -2.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2855 -2.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0003 -2.4763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7149 -2.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1445 -2.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4298 -2.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4298 -1.2349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1445 -0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1445 0.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4298 0.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4296 1.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7168 1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0019 1.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 0.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7122 0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7127 1.6513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4273 1.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 1.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8541 1.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8541 0.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1439 0.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4273 0.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1439 -0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8585 -1.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5731 -0.8234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2878 -1.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2878 -2.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5731 -2.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8585 -2.0611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0053 -0.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0003 0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5737 -0.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2882 1.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7149 0.4157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7149 1.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 2.4763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0003 -0.8226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
3 12 1 0
12 13 1 6
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
17 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
25 27 1 0
27 28 1 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 1 0
33 32 1 0
28 33 1 0
30 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
29 37 1 0
36 38 1 0
35 39 1 0
39 40 1 0
22 41 1 0
1 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.67Molecular Weight (Monoisotopic): 568.2573AlogP: 5.47#Rotatable Bonds: 8Polar Surface Area: 112.44Molecular Species: BASEHBA: 8HBD: 5#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.65CX Basic pKa: 9.12CX LogP: 4.74CX LogD: 3.05Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: 0.73
References 1. Bai R, Yao C, Zhong Z, Ge J, Bai Z, Ye X, Xie T, Xie Y.. (2021) Discovery of natural anti-inflammatory alkaloids: Potential leads for the drug discovery for the treatment of inflammation., 213 [PMID:33454546 ] [10.1016/j.ejmech.2021.113165 ]