N-(4-(7-(azetidin-1-yl)imidazo[1,2-a]pyridin-3-yl)phenyl)-5-nitrofuran-2-carboxamide

ID: ALA5280625

Max Phase: Preclinical

Molecular Formula: C21H17N5O4

Molecular Weight: 403.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2cnc3cc(N4CCC4)ccn23)cc1)c1ccc([N+](=O)[O-])o1

Standard InChI:  InChI=1S/C21H17N5O4/c27-21(18-6-7-20(30-18)26(28)29)23-15-4-2-14(3-5-15)17-13-22-19-12-16(8-11-25(17)19)24-9-1-10-24/h2-8,11-13H,1,9-10H2,(H,23,27)

Standard InChI Key:  SDQBTWAUQZBHKO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    5.5627   -0.3883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1502   -1.1027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5627   -1.8172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3252   -1.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9127   -1.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1062   -1.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0200   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7733   -0.4899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3056   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3056    0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5911   -0.8253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8766   -0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1661   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5503   -0.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5503    0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2652    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1586    1.8172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5711    1.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3817    0.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6317    0.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4286   -0.0692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8480   -0.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5627   -0.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1432    0.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0809   -0.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2737   -0.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0190    0.4894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1644    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8766    0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  8  4  1  0
  8  7  1  0
  9  7  1  0
  9 10  2  0
 11  9  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 24 25  1  0
 25 22  1  0
 21 26  1  0
 26 27  2  0
 28 27  1  0
 28 19  1  0
 16 28  1  0
 29 15  2  0
 12 30  2  0
 30 29  1  0
M  CHG  2   2   1   3  -1
M  END

Alternative Forms

  1. Parent:

    ALA5280625

    ---

Associated Targets(Human)

AGS (1999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.40Molecular Weight (Monoisotopic): 403.1281AlogP: 3.96#Rotatable Bonds: 5
Polar Surface Area: 105.92Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.62CX Basic pKa: 5.94CX LogP: 2.50CX LogD: 2.49
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -1.89

References

1. Li H, Ouyang S, Zhang Y, Peng K, Fang W, Liu Z, Wang CY, Zhang X, Wang Y..  (2022)  Structural optimization of Imidazo[1, 2-a]pyridine derivatives for the treatment of gastric cancer via STAT3 signaling pathway.,  244  [PMID:36283181] [10.1016/j.ejmech.2022.114858]

Source