2-((5-(1H-Indol-3-yl)-3-phenyl-1H-pyrazol-1-yl)-4-(4-bromo)phenyl)thiazole

ID: ALA5280680

Max Phase: Preclinical

Molecular Formula: C26H17BrN4S

Molecular Weight: 497.42

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Brc1ccc(-c2csc(-n3nc(-c4ccccc4)cc3-c3c[nH]c4ccccc34)n2)cc1

Standard InChI:  InChI=1S/C26H17BrN4S/c27-19-12-10-18(11-13-19)24-16-32-26(29-24)31-25(14-23(30-31)17-6-2-1-3-7-17)21-15-28-22-9-5-4-8-20(21)22/h1-16,28H

Standard InChI Key:  LVEAXJUTZDJKHM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   -1.5624   -0.8031    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2297   -0.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9749    0.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1499    0.4663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8950   -0.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0980   -0.5318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5427   -0.0127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2345   -0.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0210   -1.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1974   -1.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2150   -2.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1203   -2.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4925   -3.3215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2067   -2.9091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0351   -2.1024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0310   -0.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2446    0.5479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0390    0.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6222    0.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4113   -0.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6166   -0.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9889   -3.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6021   -2.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4331   -1.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6508   -1.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3872    1.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2119    1.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6222    1.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2099    2.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3893    2.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9731    1.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6222    3.3215    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 11 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 16  8  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 16 21  1  0
 21 20  2  0
 14 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 15 25  1  0
 26  3  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 26 31  1  0
 31 30  2  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280680

    ---

Associated Targets(Human)

MGAM Tclin Alpha glucosidase (860 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.42Molecular Weight (Monoisotopic): 496.0357AlogP: 7.57#Rotatable Bonds: 4
Polar Surface Area: 46.50Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.04CX LogP: 7.90CX LogD: 7.90
Aromatic Rings: 6Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -1.25

References

1. Zhu Y, Zhao J, Luo L, Gao Y, Bao H, Li P, Zhang H..  (2021)  Research progress of indole compounds with potential antidiabetic activity.,  223  [PMID:34192642] [10.1016/j.ejmech.2021.113665]

Source