(R)-N-((1-(4-(3-(3-(5-chloropyrazin-2-yl)ureido)-2-oxopiperidin-1-yl)phenyl)cyclobutyl)methyl)methanesulfonamide

ID: ALA5280720

Max Phase: Preclinical

Molecular Formula: C22H27ClN6O4S

Molecular Weight: 507.02

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)NCC1(c2ccc(N3CCC[C@@H](NC(=O)Nc4cnc(Cl)cn4)C3=O)cc2)CCC1

Standard InChI:  InChI=1S/C22H27ClN6O4S/c1-34(32,33)26-14-22(9-3-10-22)15-5-7-16(8-6-15)29-11-2-4-17(20(29)30)27-21(31)28-19-13-24-18(23)12-25-19/h5-8,12-13,17,26H,2-4,9-11,14H2,1H3,(H2,25,27,28,31)/t17-/m1/s1

Standard InChI Key:  CYOMWLMHUQWPLO-QGZVFWFLSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -5.3354   -0.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3354   -1.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6220   -2.0205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9149   -1.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9149   -0.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6238   -0.3785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2032   -0.3778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915   -0.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7799   -0.3778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0682   -0.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3565   -0.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3565    0.4439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3550   -0.7886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0667   -0.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0669    0.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7769    0.8530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4887    0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4903   -0.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7815   -0.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2004    0.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9121    0.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6238    0.8528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3354    0.4420    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.0471    0.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9238   -0.2709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7464   -0.2709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6094    1.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1906    2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7816    1.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3550   -1.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3565   -2.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0682   -1.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915   -1.6104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0471   -2.0250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  1
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 23 26  2  0
 27 20  1  0
 28 27  1  0
 28 29  1  0
 20 29  1  0
 13 30  1  0
 31 30  1  0
 32 31  1  0
 10 32  1  0
  8 33  2  0
  2 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280720

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.02Molecular Weight (Monoisotopic): 506.1503AlogP: 2.42#Rotatable Bonds: 7
Polar Surface Area: 133.39Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.55CX Basic pKa: CX LogP: 0.93CX LogD: 0.93
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.53Np Likeness Score: -1.32

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source