The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Acetoxymarsupellone ID: ALA5280749
Max Phase: Preclinical
Molecular Formula: C17H24O3
Molecular Weight: 276.38
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)C[C@H]2[C@H]3[C@@H]1[C@]2(COC(C)=O)CCCC3(C)C
Standard InChI: InChI=1S/C17H24O3/c1-10-13(19)8-12-15-14(10)17(12,9-20-11(2)18)7-5-6-16(15,3)4/h12,14-15H,1,5-9H2,2-4H3/t12-,14+,15-,17-/m0/s1
Standard InChI Key: KTMFYMFFCCKGCP-GUSZCTEKSA-N
Molfile:
RDKit 2D
23 25 0 0 0 0 0 0 0 0999 V2000
0.2032 -1.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3948 -1.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2331 -0.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2331 -1.6409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.9808 -1.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9808 -2.0297 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.6985 -0.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6387 0.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8911 0.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1733 0.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1733 0.9010 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.5145 0.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3649 1.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0093 1.9226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8018 1.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4462 2.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0199 0.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3219 0.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6509 -0.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2322 -1.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3564 0.6020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4462 -1.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6042 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 6
3 5 1 0
5 6 1 1
5 7 1 0
7 8 1 0
8 9 1 0
10 9 1 0
10 3 1 0
10 11 1 6
12 10 1 0
12 5 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
18 12 1 0
19 18 1 0
20 19 1 0
2 20 1 0
8 21 2 0
7 22 2 0
23 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 276.38Molecular Weight (Monoisotopic): 276.1725AlogP: 3.14#Rotatable Bonds: 2Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.65CX LogD: 2.65Aromatic Rings: ┄Heavy Atoms: 20QED Weighted: 0.57Np Likeness Score: 3.06