Acetoxymarsupellone

ID: ALA5280749

Max Phase: Preclinical

Molecular Formula: C17H24O3

Molecular Weight: 276.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(=O)C[C@H]2[C@H]3[C@@H]1[C@]2(COC(C)=O)CCCC3(C)C

Standard InChI:  InChI=1S/C17H24O3/c1-10-13(19)8-12-15-14(10)17(12,9-20-11(2)18)7-5-6-16(15,3)4/h12,14-15H,1,5-9H2,2-4H3/t12-,14+,15-,17-/m0/s1

Standard InChI Key:  KTMFYMFFCCKGCP-GUSZCTEKSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    0.2032   -1.9400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3948   -1.3717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2331   -0.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2331   -1.6409    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9808   -1.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9808   -2.0297    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6985   -0.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6387    0.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8911    0.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1733    0.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1733    0.9010    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5145    0.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3649    1.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0093    1.9226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8018    1.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4462    2.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0199    0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3219    0.3029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6509   -0.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2322   -1.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3564    0.6020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4462   -1.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6042   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  6
  3  5  1  0
  5  6  1  1
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 10  3  1  0
 10 11  1  6
 12 10  1  0
 12  5  1  0
 12 13  1  1
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 18 12  1  0
 19 18  1  0
 20 19  1  0
  2 20  1  0
  8 21  2  0
  7 22  2  0
 23  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280749

    ---

Associated Targets(non-human)

P388 (20296 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 276.38Molecular Weight (Monoisotopic): 276.1725AlogP: 3.14#Rotatable Bonds: 2
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.65CX LogD: 2.65
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.57Np Likeness Score: 3.06

References

1. Asakawa Y, Ludwiczuk A..  (2018)  Chemical Constituents of Bryophytes: Structures and Biological Activity.,  81  (3): [PMID:29019405] [10.1021/acs.jnatprod.6b01046]

Source