The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((2,6-dichlorobenzyl)sulfonyl)-2-(4-hydroxy-3-nitrobenzylidene)-2H-benzo[b][1,4]thiazin-3(4H)-one ID: ALA5280761
Max Phase: Preclinical
Molecular Formula: C22H14Cl2N2O6S2
Molecular Weight: 537.40
Associated Items:
Names and Identifiers Canonical SMILES: O=C1Nc2cc(S(=O)(=O)Cc3c(Cl)cccc3Cl)ccc2S/C1=C\c1ccc(O)c([N+](=O)[O-])c1
Standard InChI: InChI=1S/C22H14Cl2N2O6S2/c23-15-2-1-3-16(24)14(15)11-34(31,32)13-5-7-20-17(10-13)25-22(28)21(33-20)9-12-4-6-19(27)18(8-12)26(29)30/h1-10,27H,11H2,(H,25,28)/b21-9-
Standard InChI Key: DOMBZVXKSRQDOJ-NKVSQWTQSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.5010 1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2156 2.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9275 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9275 1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2174 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5010 1.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2174 -0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5028 -0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5028 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7882 -1.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0735 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0735 -0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7881 -0.2064 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3608 -1.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3540 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3558 -0.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3557 -0.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0686 -1.8552 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.7833 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4979 -1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4981 -2.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2110 -3.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9259 -2.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9275 -1.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2156 -1.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4820 -2.5711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -2.5711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2156 -0.6156 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.7835 -3.0930 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2174 -1.8568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2156 3.0927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7864 2.2678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7864 3.0930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0718 1.8552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
5 7 1 0
7 8 2 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 2 0
13 12 1 0
8 13 1 0
11 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
18 26 2 0
18 27 2 0
25 28 1 0
21 29 1 0
9 30 2 0
2 31 1 0
32 1 1 0
32 33 1 0
32 34 2 0
M CHG 2 32 1 33 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.40Molecular Weight (Monoisotopic): 535.9670AlogP: 5.67#Rotatable Bonds: 5Polar Surface Area: 126.61Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.63CX Basic pKa: ┄CX LogP: 4.92CX LogD: 4.11Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: -1.56
References 1. Lindberg MF, Deau E, Arfwedson J, George N, George P, Alfonso P, Corrionero A, Meijer L.. (2023) Comparative Efficacy and Selectivity of Pharmacological Inhibitors of DYRK and CLK Protein Kinases., 66 (6): [PMID:36876904 ] [10.1021/acs.jmedchem.2c02068 ]