The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl (4-(9-(2-(1,3-dioxolan-2-yl)ethyl)-6-morpholino-9H-purin-2-yl)phenyl)carbamate ID: ALA5280789
Max Phase: Preclinical
Molecular Formula: C25H32N6O5
Molecular Weight: 496.57
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)Nc1ccc(-c2nc(N3CCOCC3)c3ncn(CCC4OCCO4)c3n2)cc1
Standard InChI: InChI=1S/C25H32N6O5/c1-25(2,3)36-24(32)27-18-6-4-17(5-7-18)21-28-22(30-10-12-33-13-11-30)20-23(29-21)31(16-26-20)9-8-19-34-14-15-35-19/h4-7,16,19H,8-15H2,1-3H3,(H,27,32)
Standard InChI Key: NELCXEWHJNTFLI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-2.1800 0.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4654 0.5701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7536 0.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7536 -0.6669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4636 -1.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1800 -0.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4636 -1.9039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7490 -2.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7490 -3.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4637 -3.5542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1783 -3.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1783 -2.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9679 0.4138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9680 -0.9266 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4549 -0.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0389 0.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0387 1.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6741 1.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3889 1.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3905 0.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6787 0.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1036 1.8066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8182 1.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5328 1.8066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2475 1.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9621 1.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8349 0.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6600 0.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8182 0.5688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1815 1.2109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9786 1.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1921 2.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9621 2.5170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9189 3.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1223 3.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6730 2.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 5 1 0
7 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
7 12 1 0
12 11 1 0
1 13 1 0
6 14 1 0
14 15 2 0
15 13 1 0
16 3 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
16 21 1 0
21 20 2 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
23 29 2 0
13 30 1 0
30 31 1 0
31 32 1 0
33 32 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.57Molecular Weight (Monoisotopic): 496.2434AlogP: 3.44#Rotatable Bonds: 6Polar Surface Area: 112.86Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.77CX Basic pKa: 3.58CX LogP: 3.70CX LogD: 3.70Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: -1.45
References 1. Huang J, Chen L, Wu J, Ai D, Zhang JQ, Chen TG, Wang L.. (2022) Targeting the PI3K/AKT/mTOR Signaling Pathway in the Treatment of Human Diseases: Current Status, Trends, and Solutions., 65 (24.0): [PMID:36503229 ] [10.1021/acs.jmedchem.2c01070 ]