tert-butyl (4-(9-(2-(1,3-dioxolan-2-yl)ethyl)-6-morpholino-9H-purin-2-yl)phenyl)carbamate

ID: ALA5280789

Max Phase: Preclinical

Molecular Formula: C25H32N6O5

Molecular Weight: 496.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)Nc1ccc(-c2nc(N3CCOCC3)c3ncn(CCC4OCCO4)c3n2)cc1

Standard InChI:  InChI=1S/C25H32N6O5/c1-25(2,3)36-24(32)27-18-6-4-17(5-7-18)21-28-22(30-10-12-33-13-11-30)20-23(29-21)31(16-26-20)9-8-19-34-14-15-35-19/h4-7,16,19H,8-15H2,1-3H3,(H,27,32)

Standard InChI Key:  NELCXEWHJNTFLI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -2.1800    0.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4654    0.5701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7536    0.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7536   -0.6669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4636   -1.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1800   -0.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4636   -1.9039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7490   -2.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7490   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4637   -3.5542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1783   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1783   -2.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9679    0.4138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9680   -0.9266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4549   -0.2563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0389    0.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0387    1.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6741    1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3889    1.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3905    0.5729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6787    0.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1036    1.8066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8182    1.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5328    1.8066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2475    1.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9621    1.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8349    0.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6600    0.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8182    0.5688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1815    1.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9786    1.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1921    2.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9621    2.5170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9189    3.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1223    3.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6730    2.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  5  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
  7 12  1  0
 12 11  1  0
  1 13  1  0
  6 14  1  0
 14 15  2  0
 15 13  1  0
 16  3  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 16 21  1  0
 21 20  2  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 23 29  2  0
 13 30  1  0
 30 31  1  0
 31 32  1  0
 33 32  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280789

    ---

Associated Targets(Human)

MTOR Tclin Serine/threonine-protein kinase mTOR (13850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.57Molecular Weight (Monoisotopic): 496.2434AlogP: 3.44#Rotatable Bonds: 6
Polar Surface Area: 112.86Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.77CX Basic pKa: 3.58CX LogP: 3.70CX LogD: 3.70
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: -1.45

References

1. Huang J, Chen L, Wu J, Ai D, Zhang JQ, Chen TG, Wang L..  (2022)  Targeting the PI3K/AKT/mTOR Signaling Pathway in the Treatment of Human Diseases: Current Status, Trends, and Solutions.,  65  (24.0): [PMID:36503229] [10.1021/acs.jmedchem.2c01070]

Source