The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-nitro-N-(4-(5,6,7-trimethoxy-4-oxo-4H-chromen-2-yl)phenyl)benzamide ID: ALA5280817
Max Phase: Preclinical
Molecular Formula: C25H20N2O8
Molecular Weight: 476.44
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2oc(-c3ccc(NC(=O)c4ccc([N+](=O)[O-])cc4)cc3)cc(=O)c2c(OC)c1OC
Standard InChI: InChI=1S/C25H20N2O8/c1-32-21-13-20-22(24(34-3)23(21)33-2)18(28)12-19(35-20)14-4-8-16(9-5-14)26-25(29)15-6-10-17(11-7-15)27(30)31/h4-13H,1-3H3,(H,26,29)
Standard InChI Key: JAHHEMMLRUIDPY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-4.2842 -0.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5696 -0.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8578 -0.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8578 -1.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5678 -1.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2842 -1.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9989 -1.8579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7135 -1.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1400 -1.8558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4283 -1.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4301 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1451 -0.2056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7155 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7153 0.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0024 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7123 0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7139 -0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0021 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4270 1.0302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1417 0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8562 1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 1.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5694 2.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2842 1.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2858 1.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5740 0.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1417 -0.2074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1400 -2.6810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9989 -0.2043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9989 0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5678 -2.6786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2825 -3.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9988 2.2660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7135 1.8535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9989 3.0912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
3 12 1 0
13 11 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
20 27 2 0
9 28 2 0
1 29 1 0
29 30 1 0
5 31 1 0
31 32 1 0
33 24 1 0
33 34 1 0
33 35 2 0
M CHG 2 33 1 34 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.44Molecular Weight (Monoisotopic): 476.1220AlogP: 4.65#Rotatable Bonds: 7Polar Surface Area: 130.14Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 14.00CX Basic pKa: ┄CX LogP: 3.53CX LogD: 3.53Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -0.22
References 1. Hassan AHE, Lee KT, Lee YS.. (2020) Flavone-based arylamides as potential anticancers: Design, synthesis and in vitro cell-based/cell-free evaluations., 187 [PMID:31877541 ] [10.1016/j.ejmech.2019.111965 ]