The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6-((4-(benzo[d]thiazol-5-yl)-5-fluoropyrimidin-2-yl)amino)pyridin-3-yl)(4-phenylpiperazin-1-yl)methanone ID: ALA5280825
Max Phase: Preclinical
Molecular Formula: C27H22FN7OS
Molecular Weight: 511.59
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(Nc2ncc(F)c(-c3ccc4scnc4c3)n2)nc1)N1CCN(c2ccccc2)CC1
Standard InChI: InChI=1S/C27H22FN7OS/c28-21-16-30-27(33-25(21)18-6-8-23-22(14-18)31-17-37-23)32-24-9-7-19(15-29-24)26(36)35-12-10-34(11-13-35)20-4-2-1-3-5-20/h1-9,14-17H,10-13H2,(H,29,30,32,33)
Standard InChI Key: ZKHVRKKJZLTSGJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
3.2153 2.6721 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.2153 1.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9291 1.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9291 0.6085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 0.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2126 -0.6277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4962 -1.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4962 -1.8606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7765 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0652 -1.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3478 -2.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3639 -1.8437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0834 -2.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7893 -1.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7893 -1.0045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 -0.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2189 -0.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9291 -0.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9291 0.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2022 0.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5002 0.2389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0696 -0.5971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3639 -1.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3478 -3.0858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0652 -1.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7848 -0.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5001 0.6108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5001 1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7856 1.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7856 2.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0712 3.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3567 2.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4276 2.9282 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.9126 2.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4276 1.5931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3567 1.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0712 1.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 22 1 0
22 23 1 0
23 12 1 0
11 24 2 0
10 25 1 0
25 26 2 0
26 7 1 0
5 27 1 0
27 28 2 0
28 2 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 32 1 0
36 37 2 0
37 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.59Molecular Weight (Monoisotopic): 511.1591AlogP: 4.99#Rotatable Bonds: 5Polar Surface Area: 87.14Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.62CX Basic pKa: 3.45CX LogP: 4.90CX LogD: 4.89Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.87
References 1. Yuan K, Shen H, Zheng M, Xia F, Li Q, Chen W, Ji M, Yang H, Zhuang X, Cai Z, Min W, Wang X, Xiao Y, Yang P.. (2023) Discovery of Potent DYRK2 Inhibitors with High Selectivity, Great Solubility, and Excellent Safety Properties for the Treatment of Prostate Cancer., 66 (6): [PMID:36800260 ] [10.1021/acs.jmedchem.3c00106 ]