(6-((4-(benzo[d]thiazol-5-yl)-5-fluoropyrimidin-2-yl)amino)pyridin-3-yl)(4-phenylpiperazin-1-yl)methanone

ID: ALA5280825

Max Phase: Preclinical

Molecular Formula: C27H22FN7OS

Molecular Weight: 511.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(Nc2ncc(F)c(-c3ccc4scnc4c3)n2)nc1)N1CCN(c2ccccc2)CC1

Standard InChI:  InChI=1S/C27H22FN7OS/c28-21-16-30-27(33-25(21)18-6-8-23-22(14-18)31-17-37-23)32-24-9-7-19(15-29-24)26(36)35-12-10-34(11-13-35)20-4-2-1-3-5-20/h1-9,14-17H,10-13H2,(H,29,30,32,33)

Standard InChI Key:  ZKHVRKKJZLTSGJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    3.2153    2.6721    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2153    1.8471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9291    1.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9291    0.6085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126    0.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126   -0.6277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4962   -1.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4962   -1.8606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7765   -2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0652   -1.8534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3478   -2.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3639   -1.8437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0834   -2.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7893   -1.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7893   -1.0045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002   -0.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2189   -0.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291   -0.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291    0.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2022    0.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002    0.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0696   -0.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3639   -1.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3478   -3.0858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0652   -1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7848   -0.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001    0.6108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001    1.4358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7856    1.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7856    2.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712    3.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567    2.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4276    2.9282    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9126    2.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4276    1.5931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3567    1.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712    1.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 15 22  1  0
 22 23  1  0
 23 12  1  0
 11 24  2  0
 10 25  1  0
 25 26  2  0
 26  7  1  0
  5 27  1  0
 27 28  2  0
 28  2  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 32  1  0
 36 37  2  0
 37 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280825

    ---

Associated Targets(Human)

DYRK2 Tchem Dual-specificity tyrosine-phosphorylation regulated kinase 2 (2095 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.59Molecular Weight (Monoisotopic): 511.1591AlogP: 4.99#Rotatable Bonds: 5
Polar Surface Area: 87.14Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.62CX Basic pKa: 3.45CX LogP: 4.90CX LogD: 4.89
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.87

References

1. Yuan K, Shen H, Zheng M, Xia F, Li Q, Chen W, Ji M, Yang H, Zhuang X, Cai Z, Min W, Wang X, Xiao Y, Yang P..  (2023)  Discovery of Potent DYRK2 Inhibitors with High Selectivity, Great Solubility, and Excellent Safety Properties for the Treatment of Prostate Cancer.,  66  (6): [PMID:36800260] [10.1021/acs.jmedchem.3c00106]

Source