The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-(4-((2-((methoxycarbonyl)amino)-3-phenyl-N-(4-(thiophen-2-yl)thiazol-2-yl)propanamido)methyl)phenyl)sulfamic acid ID: ALA5280845
Max Phase: Preclinical
Molecular Formula: C25H24N4O6S3
Molecular Weight: 572.69
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)N[C@@H](Cc1ccccc1)C(=O)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2cccs2)cs1
Standard InChI: InChI=1S/C25H24N4O6S3/c1-35-25(31)27-20(14-17-6-3-2-4-7-17)23(30)29(24-26-21(16-37-24)22-8-5-13-36-22)15-18-9-11-19(12-10-18)28-38(32,33)34/h2-13,16,20,28H,14-15H2,1H3,(H,27,31)(H,32,33,34)/t20-/m0/s1
Standard InChI Key: YFXBEQFXOJAPBF-FQEVSTJZSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
1.8467 1.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1285 0.6512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4178 1.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3003 0.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3077 -0.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0258 -0.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7366 -0.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4547 -0.5543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1656 -0.1354 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1582 0.6895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7293 0.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0111 1.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1212 -0.1737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8540 1.8823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9909 -0.1354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3792 -0.9326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5614 0.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8321 -0.5927 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.6394 -1.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8371 -1.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5117 -0.7234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4245 -2.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2761 1.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2761 1.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8371 -2.9157 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.2657 -3.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4688 -3.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3765 -2.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9907 2.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9900 3.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2750 3.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5631 3.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5583 2.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5614 -0.1806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2761 -0.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2761 -1.4185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9909 -1.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9909 -0.1806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
7 6 1 0
7 8 1 0
9 8 1 0
9 10 1 0
7 11 2 0
11 12 1 0
12 4 2 0
13 2 1 0
1 14 2 0
9 15 2 0
9 16 2 0
1 17 1 0
18 13 1 0
18 19 1 0
19 20 2 0
21 20 1 0
13 21 2 0
20 22 1 0
23 17 1 0
23 24 1 0
25 22 1 0
25 26 1 0
26 27 2 0
28 27 1 0
22 28 2 0
29 24 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
24 33 1 0
17 34 1 6
34 35 1 0
35 36 1 0
36 37 1 0
35 38 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.69Molecular Weight (Monoisotopic): 572.0858AlogP: 4.59#Rotatable Bonds: 10Polar Surface Area: 137.93Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.87CX Basic pKa: ┄CX LogP: 2.64CX LogD: 1.81Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -1.46
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]