(S)-(4-((2-((methoxycarbonyl)amino)-3-phenyl-N-(4-(thiophen-2-yl)thiazol-2-yl)propanamido)methyl)phenyl)sulfamic acid

ID: ALA5280845

Max Phase: Preclinical

Molecular Formula: C25H24N4O6S3

Molecular Weight: 572.69

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)N[C@@H](Cc1ccccc1)C(=O)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2cccs2)cs1

Standard InChI:  InChI=1S/C25H24N4O6S3/c1-35-25(31)27-20(14-17-6-3-2-4-7-17)23(30)29(24-26-21(16-37-24)22-8-5-13-36-22)15-18-9-11-19(12-10-18)28-38(32,33)34/h2-13,16,20,28H,14-15H2,1H3,(H,27,31)(H,32,33,34)/t20-/m0/s1

Standard InChI Key:  YFXBEQFXOJAPBF-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    1.8467    1.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1285    0.6512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4178    1.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3003    0.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3077   -0.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0258   -0.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7366   -0.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4547   -0.5543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1656   -0.1354    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1582    0.6895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7293    0.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0111    1.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1212   -0.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8540    1.8823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9909   -0.1354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3792   -0.9326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614    0.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8321   -0.5927    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6394   -1.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8371   -1.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5117   -0.7234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4245   -2.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761    1.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761    1.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8371   -2.9157    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.2657   -3.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4688   -3.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3765   -2.3796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9907    2.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9900    3.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2750    3.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5631    3.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5583    2.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614   -0.1806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761   -0.5932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761   -1.4185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9909   -1.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9909   -0.1806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  1 14  2  0
  9 15  2  0
  9 16  2  0
  1 17  1  0
 18 13  1  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 13 21  2  0
 20 22  1  0
 23 17  1  0
 23 24  1  0
 25 22  1  0
 25 26  1  0
 26 27  2  0
 28 27  1  0
 22 28  2  0
 29 24  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 24 33  1  0
 17 34  1  6
 34 35  1  0
 35 36  1  0
 36 37  1  0
 35 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5280845

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 572.69Molecular Weight (Monoisotopic): 572.0858AlogP: 4.59#Rotatable Bonds: 10
Polar Surface Area: 137.93Molecular Species: ACIDHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: -1.87CX Basic pKa: CX LogP: 2.64CX LogD: 1.81
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -1.46

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source