The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S)-2-[[(1S)-3-amino-1-[3-[(1S)-1,5-diaminopentyl]-1,2,4-oxadiazol-5-yl]-3-oxo-propyl]carbamoylamino]-3-hydroxy-butanoic acid ID: ALA5280876
Max Phase: Preclinical
Molecular Formula: C15H27N7O6
Molecular Weight: 401.42
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](O)[C@H](NC(=O)N[C@@H](CC(N)=O)c1nc([C@@H](N)CCCCN)no1)C(=O)O
Standard InChI: InChI=1S/C15H27N7O6/c1-7(23)11(14(25)26)20-15(27)19-9(6-10(18)24)13-21-12(22-28-13)8(17)4-2-3-5-16/h7-9,11,23H,2-6,16-17H2,1H3,(H2,18,24)(H,25,26)(H2,19,20,27)/t7-,8-,9-,11-/m0/s1
Standard InChI Key: DYSQQRYSWLRGIQ-KBIXCLLPSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
-3.2781 -0.2887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5636 0.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8489 -0.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0954 0.0465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5434 -0.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9558 -1.2807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7627 -1.1092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2812 -0.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6936 0.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2812 0.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6936 1.5762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5434 0.8620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6936 -1.2806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5183 -1.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9307 -1.9948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7554 -1.9948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1678 -2.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9925 -2.7091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7554 -3.4233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1678 -1.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7554 -0.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9925 -1.2806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9307 -0.5664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5636 0.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2783 1.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2783 2.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9925 2.5986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9925 3.4233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
4 3 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 3 2 0
5 8 1 0
8 9 1 6
9 10 1 0
10 11 1 0
10 12 2 0
8 13 1 0
13 14 1 0
14 15 1 0
16 15 1 1
16 17 1 0
17 18 2 0
17 19 1 0
16 20 1 0
20 21 1 0
20 22 1 6
14 23 2 0
2 24 1 1
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.42Molecular Weight (Monoisotopic): 401.2023AlogP: -1.75#Rotatable Bonds: 12Polar Surface Area: 232.71Molecular Species: ZWITTERIONHBA: 9HBD: 7#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 10#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.50CX Basic pKa: 10.21CX LogP: -5.14CX LogD: -5.48Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.19Np Likeness Score: -0.40
References 1. Wu C, Cao X, Zhang X.. (2021) VISTA inhibitors in cancer immunotherapy: a short perspective on recent progresses., 12 (10.0): [PMID:34778768 ] [10.1039/D1MD00185J ]