2-(5-(6-(4-fluorophenyl)benzo[d]oxazol-2-yl)-2-methoxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid

ID: ALA5280877

Max Phase: Preclinical

Molecular Formula: C29H17FN2O6

Molecular Weight: 508.46

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nc3ccc(-c4ccc(F)cc4)cc3o2)cc1N1C(=O)c2ccc(C(=O)O)cc2C1=O

Standard InChI:  InChI=1S/C29H17FN2O6/c1-37-24-11-6-17(13-23(24)32-27(33)20-9-4-18(29(35)36)12-21(20)28(32)34)26-31-22-10-5-16(14-25(22)38-26)15-2-7-19(30)8-3-15/h2-14H,1H3,(H,35,36)

Standard InChI Key:  ZKXAOEZFHYBNIV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -4.1519    1.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4373    2.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7254    1.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7254    1.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4355    0.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1519    1.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9406    0.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9406    2.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4556    1.5317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6305    1.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2176    2.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6050    2.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0177    1.5306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6085    0.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2161    0.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0211    0.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8414    0.0179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0129   -0.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2986   -1.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6857   -0.6492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7247   -1.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7249   -2.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0152   -2.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2988   -2.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4396   -2.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1544   -2.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8665   -2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8665   -3.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1562   -3.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4396   -3.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7271    0.0672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7271    2.9964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8665    2.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5811    1.9440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8665    3.1818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6302    2.9609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2176    3.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5811   -3.6755    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  1  0
  9  7  1  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 10 15  1  0
 15 14  2  0
 16 14  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  2  0
 18 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 25 22  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 25 30  1  0
 30 29  2  0
  7 31  2  0
  8 32  2  0
  1 33  1  0
 33 34  2  0
 33 35  1  0
 11 36  1  0
 36 37  1  0
 28 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5280877

    ---

Associated Targets(Human)

HPSE Tchem Heparanase (634 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.46Molecular Weight (Monoisotopic): 508.1071AlogP: 5.81#Rotatable Bonds: 5
Polar Surface Area: 109.94Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.49CX Basic pKa: 0.17CX LogP: 5.24CX LogD: 1.86
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -1.11

References

1. Fu K, Bai Z, Chen L, Ye W, Wang M, Hu J, Liu C, Zhou W..  (2020)  Antitumor activity and structure-activity relationship of heparanase inhibitors: Recent advances.,  193  [PMID:32222663] [10.1016/j.ejmech.2020.112221]

Source