6-Bromo-3-(3-chlorostyryl)-2-methylquinazolin-4(3H)-one

ID: ALA5280935

Max Phase: Preclinical

Molecular Formula: C17H12BrClN2O

Molecular Weight: 375.65

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc2ccc(Br)cc2c(=O)n1/C=C/c1cccc(Cl)c1

Standard InChI:  InChI=1S/C17H12BrClN2O/c1-11-20-16-6-5-13(18)10-15(16)17(22)21(11)8-7-12-3-2-4-14(19)9-12/h2-10H,1H3/b8-7+

Standard InChI Key:  CDAZDGMTXNAGLK-BQYQJAHWSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   -3.5700   -0.2040    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -2.8556   -0.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8556   -1.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1394   -1.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295   -1.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7119   -1.8551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7138   -1.8511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -0.6178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4264   -0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1409   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584   -0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700   -0.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700    0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8538    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1409    0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8538    1.8551    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.7170   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7170    0.6194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4295   -0.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1412   -0.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 16 18  1  0
  9 19  1  0
 19 20  2  0
 21 19  1  0
  5 21  2  0
 21 22  1  0
 22  2  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5280935

    ---

Associated Targets(non-human)

Tobacco mosaic virus (2972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.65Molecular Weight (Monoisotopic): 373.9822AlogP: 4.75#Rotatable Bonds: 2
Polar Surface Area: 34.89Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.68CX LogP: 4.48CX LogD: 4.48
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.65Np Likeness Score: -0.99

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source