The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5280954
Max Phase: Preclinical
Molecular Formula: C19H17ClN2O5S
Molecular Weight: 420.87
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nc(=O)c2c(CCCCCl)cc(=O)oc2[nH]1)Oc1ccccc1
Standard InChI: InChI=1S/C19H17ClN2O5S/c20-9-5-4-6-12-10-14(23)27-18-16(12)17(25)21-19(22-18)28-11-15(24)26-13-7-2-1-3-8-13/h1-3,7-8,10H,4-6,9,11H2,(H,21,22,25)
Standard InChI Key: HCEKLYIZXNAZCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-2.8581 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 0.6195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 -1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8581 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7148 0.6195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0004 0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0004 -0.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7148 -1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7148 -1.8555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5728 0.6196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7141 0.6196 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 -1.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8584 -2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8584 -3.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5730 -3.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5730 -4.3312 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.7141 1.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4288 1.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4288 2.6826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1435 1.4448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1435 3.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1437 3.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5714 3.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5730 3.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8612 2.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
4 10 1 0
10 11 2 0
1 12 2 0
8 13 1 0
5 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.87Molecular Weight (Monoisotopic): 420.0547AlogP: 3.14#Rotatable Bonds: 8Polar Surface Area: 102.26Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.13CX Basic pKa: ┄CX LogP: 3.22CX LogD: 2.19Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.15Np Likeness Score: -0.76
References 1. Elattar KM, El-Khateeb AY, Hamed SE.. (2022) Insights into the recent progress in the medicinal chemistry of pyranopyrimidine analogs., 13 (5.0): [PMID:35694689 ] [10.1039/d2md00076h ]