(4-(4,5-dichloro-1H-pyrrole-2-carboxamido)-3-methoxybenzoyl)glycine

ID: ALA5280982

Max Phase: Preclinical

Molecular Formula: C15H13Cl2N3O5

Molecular Weight: 386.19

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)NCC(=O)O)ccc1NC(=O)c1cc(Cl)c(Cl)[nH]1

Standard InChI:  InChI=1S/C15H13Cl2N3O5/c1-25-11-4-7(14(23)18-6-12(21)22)2-3-9(11)20-15(24)10-5-8(16)13(17)19-10/h2-5,19H,6H2,1H3,(H,18,23)(H,20,24)(H,21,22)

Standard InChI Key:  AARJHMDWLTVIEN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   -0.3625    0.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3520    1.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0639    0.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0639    0.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3538   -0.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3625    0.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0771   -0.3862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7918    0.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5065   -0.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5926   -1.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3995   -1.3781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8120   -0.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2599   -0.0509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6371   -0.6637    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.8121   -2.0928    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.7918    0.8513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3538   -1.2071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0685   -1.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7786    1.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7786    2.0928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4932    0.8550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2080    1.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9226    0.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6371    1.2677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9226    0.0299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  9  1  0
 12 14  1  0
 11 15  1  0
  8 16  2  0
  5 17  1  0
 17 18  1  0
  3 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5280982

    ---

Associated Targets(non-human)

gyrB DNA gyrase (2092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.19Molecular Weight (Monoisotopic): 385.0232AlogP: 2.40#Rotatable Bonds: 6
Polar Surface Area: 120.52Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 3.23CX Basic pKa: CX LogP: 1.38CX LogD: -2.07
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.61Np Likeness Score: -1.12

References

1. Dighe SN, Collet TA..  (2020)  Recent advances in DNA gyrase-targeted antimicrobial agents.,  199  [PMID:32460040] [10.1016/j.ejmech.2020.112326]

Source