Oscillatoxin I

ID: ALA5281013

Max Phase: Preclinical

Molecular Formula: C32H43BrO8

Molecular Weight: 635.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H](CC[C@H](C)[C@@H](O)[C@@H](C)/C=C/C1=C(C(=O)O[C@@H]2CC(=O)O[C@@H]2C)C(=O)[C@H](C)CC1(C)C)c1cc(O)ccc1Br

Standard InChI:  InChI=1S/C32H43BrO8/c1-17(29(36)18(2)9-13-25(39-7)22-14-21(34)10-12-24(22)33)8-11-23-28(30(37)19(3)16-32(23,5)6)31(38)41-26-15-27(35)40-20(26)4/h8,10-12,14,17-20,25-26,29,34,36H,9,13,15-16H2,1-7H3/b11-8+/t17-,18-,19+,20+,25-,26+,29-/m0/s1

Standard InChI Key:  QKLWRXPNVSGLOD-BZILHIHASA-N

Molfile:  

 
     RDKit          2D

 41 43  0  0  0  0  0  0  0  0999 V2000
   -4.2844    2.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2844    1.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5700    0.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8555    1.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8555    2.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5700    2.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0292    2.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4423    2.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1412    0.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4270    1.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128    0.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0014    1.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0014    2.2008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7156    0.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4298    1.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1441    0.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8583    1.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5725    0.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2870    1.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9987    0.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9987    0.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2888   -0.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5725    0.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2888   -1.0972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2870    2.2006    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.8583    2.2008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1441    2.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7156    0.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128    0.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5700    0.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557   -0.2735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557   -1.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1415   -1.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3268   -2.3316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1279   -2.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4598   -1.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2564   -1.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7437   -2.9148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2842   -0.2735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9987    0.9637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9987    2.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  5  7  1  0
  5  8  1  0
  4  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  6
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 22 24  1  0
 19 25  1  0
 17 26  1  6
 26 27  1  0
 14 28  1  6
 11 29  1  1
  3 30  1  0
 30 31  1  0
 32 31  1  6
 33 32  1  0
 33 34  1  0
 34 35  1  0
 36 35  1  0
 32 36  1  0
 36 37  1  6
 34 38  2  0
 30 39  2  0
  2 40  2  0
  1 41  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5281013

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Nitzschia amabilis (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 635.59Molecular Weight (Monoisotopic): 634.2141AlogP: 5.99#Rotatable Bonds: 11
Polar Surface Area: 119.36Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.92CX Basic pKa: CX LogP: 6.54CX LogD: 6.53
Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: 1.65

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source