The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5281014
Max Phase: Preclinical
Molecular Formula: C15H20O5
Molecular Weight: 280.32
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1C[C@H]2OC(=O)[C@@H](C)[C@H]2[C@H](O)[C@]2(C)C(=O)C3OC3[C@@H]12
Standard InChI: InChI=1S/C15H20O5/c1-5-4-7-8(6(2)14(18)19-7)12(16)15(3)9(5)10-11(20-10)13(15)17/h5-12,16H,4H2,1-3H3/t5-,6+,7-,8-,9-,10?,11?,12+,15-/m1/s1
Standard InChI Key: YKAPJDFMXLHZTC-BRMBMJFOSA-N
Molfile:
RDKit 2D
23 26 0 0 0 0 0 0 0 0999 V2000
-0.9451 0.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2970 1.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5073 0.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8661 0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5079 -0.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2970 -0.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9451 -0.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7055 0.0865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8495 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1125 -1.1047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5108 -1.5235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7565 -0.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2315 0.1968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7350 0.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9703 -1.2608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5651 0.9626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5651 -1.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1125 -1.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5108 1.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1589 1.4205 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9451 -1.0365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4505 0.7927 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.5079 -1.3677 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 0
7 6 1 0
4 8 1 0
8 9 1 0
10 9 1 0
5 10 1 0
6 11 1 6
7 12 1 0
12 13 1 0
14 13 1 0
1 14 1 0
12 15 2 0
13 16 1 0
14 16 1 0
9 17 2 0
10 18 1 1
2 19 1 6
1 20 1 6
7 21 1 1
4 22 1 6
5 23 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 280.32Molecular Weight (Monoisotopic): 280.1311AlogP: 0.54#Rotatable Bonds: ┄Polar Surface Area: 76.13Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.00CX LogD: 1.00Aromatic Rings: ┄Heavy Atoms: 20QED Weighted: 0.52Np Likeness Score: 3.07
References 1. Gomes AR, Varela CL, Tavares-da-Silva EJ, Roleira FMF.. (2020) Epoxide containing molecules: A good or a bad drug design approach., 201 [PMID:32526552 ] [10.1016/j.ejmech.2020.112327 ]