3-(N-(3,4,5-trimethoxyphenyl)quinoline-8-sulfonamido)propyl 4-methylpiperazine-1-carbodithioate

ID: ALA5281044

Max Phase: Preclinical

Molecular Formula: C27H34N4O5S3

Molecular Weight: 590.79

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N(CCCSC(=S)N2CCN(C)CC2)S(=O)(=O)c2cccc3cccnc23)cc(OC)c1OC

Standard InChI:  InChI=1S/C27H34N4O5S3/c1-29-13-15-30(16-14-29)27(37)38-17-7-12-31(21-18-22(34-2)26(36-4)23(19-21)35-3)39(32,33)24-10-5-8-20-9-6-11-28-25(20)24/h5-6,8-11,18-19H,7,12-17H2,1-4H3

Standard InChI Key:  ZCKRQRRIUQBPCX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -3.5566    1.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5566    0.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8433    0.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1361    0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1361    1.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8450    2.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8450    2.8725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5566    3.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4245    0.4082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7129    0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013    0.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7102    0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4218    0.4082    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1334    0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8451    0.4082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5566    0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2683    0.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2683   -0.4135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5566   -0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8451   -0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9798   -0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1334    1.6407    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4245   -0.4135    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1363   -0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1363   -1.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8462   -2.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5596   -1.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5596   -0.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8508   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8462   -2.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1357   -3.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4303   -2.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4303   -2.0555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6028   -0.4135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9087   -1.0597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2682    0.4045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2682   -0.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2682    2.0511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9798    1.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 15 20  1  0
 18 21  1  0
 14 22  2  0
  9 23  1  0
 23 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
 26 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 25 33  1  0
 23 34  2  0
 23 35  2  0
  2 36  1  0
 36 37  1  0
  1 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281044

    ---

Associated Targets(Human)

MDA-MB-453 (1139 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SNU-423 (156 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RT-112 (346 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 590.79Molecular Weight (Monoisotopic): 590.1691AlogP: 4.11#Rotatable Bonds: 10
Polar Surface Area: 84.44Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.68CX LogP: 3.68CX LogD: 3.61
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -1.29

References

1. Van de Walle T, Cools L, Mangelinckx S, D'hooghe M..  (2021)  Recent contributions of quinolines to antimalarial and anticancer drug discovery research.,  226  [PMID:34655985] [10.1016/j.ejmech.2021.113865]

Source