2-cyano-N'-(1-((3S,8S,9R,10S,13R,14R)-3-hydroxy-8,9,10,13,14-pentamethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)ethylidene)-2-(4-methyl-3-phenylthiazol-2(3H)-ylidene)acetohydrazide

ID: ALA5281096

Max Phase: Preclinical

Molecular Formula: C37H48N4O2S

Molecular Weight: 612.88

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=CS/C(=C(/C#N)C(=O)N/N=C(\C)C2CC[C@@]3(C)[C@]4(C)CC=C5C[C@@H](O)CC[C@]5(C)[C@@]4(C)CC[C@]23C)N1c1ccccc1

Standard InChI:  InChI=1S/C37H48N4O2S/c1-24-23-44-32(41(24)27-11-9-8-10-12-27)29(22-38)31(43)40-39-25(2)30-15-18-35(5)34(30,4)19-20-36(6)33(3)16-14-28(42)21-26(33)13-17-37(35,36)7/h8-13,23,28,30,42H,14-21H2,1-7H3,(H,40,43)/b32-29-,39-25+/t28-,30?,33-,34+,35+,36+,37-/m0/s1

Standard InChI Key:  OFDMAALEESNCEU-PGBHRJCUSA-N

Molfile:  

 
     RDKit          2D

 44 49  0  0  0  0  0  0  0  0999 V2000
    1.7834    4.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5699    3.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7763    3.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1977    3.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4104    4.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1995    4.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1507    2.6530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9884    2.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2727    1.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6276    1.4214    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.9381    1.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1446    1.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5638    2.2278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0170    2.8087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9320    0.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1385    0.6408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5129    0.2725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3003   -0.5208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8812   -1.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6746   -0.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6685   -1.8952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8682   -2.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9592   -1.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8682   -2.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9580   -3.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6473   -3.2101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1370   -2.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1569   -3.3760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1569   -2.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5542   -2.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5542   -3.7868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5542   -2.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1569   -1.7334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2654   -3.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2654   -2.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2654   -4.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5542   -4.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1569   -4.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9766   -4.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6878   -4.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3992   -4.6079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6878   -3.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9766   -2.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3992    3.3978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  7  2  1  0
  7  8  1  0
  8  9  2  0
 10  9  1  0
 11 10  1  0
  7 11  1  0
 12 11  2  0
 12 13  1  0
 13 14  3  0
 15 12  1  0
 15 16  2  0
 17 15  1  0
 18 17  1  0
 19 18  2  0
 19 20  1  0
 19 21  1  0
 22 21  1  0
 22 23  1  1
 24 22  1  0
 24 25  1  6
 24 26  1  0
 26 27  1  0
 21 27  1  0
 28 24  1  0
 28 29  1  1
 28 30  1  0
 30 31  1  6
 30 32  1  0
 33 32  1  0
 22 33  1  0
 34 30  1  0
 34 35  1  1
 36 34  1  0
 36 37  2  0
 37 38  1  0
 38 28  1  0
 39 36  1  0
 40 39  1  0
 40 41  1  1
 42 40  1  0
 42 43  1  0
 34 43  1  0
  8 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281096

    ---

Associated Targets(Human)

NCI-H460 (60772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 612.88Molecular Weight (Monoisotopic): 612.3498AlogP: 8.44#Rotatable Bonds: 4
Polar Surface Area: 88.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.57CX Basic pKa: 1.76CX LogP: 6.72CX LogD: 6.72
Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.12Np Likeness Score: 0.70

References

1. Sharma PC, Bansal KK, Sharma A, Sharma D, Deep A..  (2020)  Thiazole-containing compounds as therapeutic targets for cancer therapy.,  188  [PMID:31926469] [10.1016/j.ejmech.2019.112016]

Source