furan-2-yl(4-(2-(morpholinomethyl)-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl)methanone

ID: ALA5281110

Max Phase: Preclinical

Molecular Formula: C24H29N5O3S

Molecular Weight: 467.60

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccco1)N1CCN(c2nc(CN3CCOCC3)nc3sc4c(c23)CCCC4)CC1

Standard InChI:  InChI=1S/C24H29N5O3S/c30-24(18-5-3-13-32-18)29-9-7-28(8-10-29)22-21-17-4-1-2-6-19(17)33-23(21)26-20(25-22)16-27-11-14-31-15-12-27/h3,5,13H,1-2,4,6-12,14-16H2

Standard InChI Key:  QEVUAKDVSVJAFV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   -2.9934    2.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7494    2.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6689    1.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8517    1.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4412    2.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6204    2.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2099    2.8819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2099    1.4600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3891    1.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213    0.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3891    0.0382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2099    0.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6204    0.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213   -0.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8191   -0.5919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2866   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9622   -1.9706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1613   -2.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3283   -2.7160    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1074   -2.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8186   -2.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5297   -2.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5297   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8186   -1.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1074   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3072   -1.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1075   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5180   -0.5271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1075    0.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5180    0.8946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3389    0.8946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7494    0.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3389   -0.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  4  5  2  0
  5  1  1  0
  6  5  1  0
  6  7  2  0
  8  6  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
 14 11  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 23 24  1  0
 25 24  1  0
 20 25  2  0
 25 26  1  0
 26 14  1  0
 26 18  2  0
 16 27  1  0
 27 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281110

    ---

Associated Targets(Human)

GPR55 Tclin G-protein coupled receptor 55 (1594 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.60Molecular Weight (Monoisotopic): 467.1991AlogP: 2.96#Rotatable Bonds: 4
Polar Surface Area: 74.94Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.75CX LogP: 3.66CX LogD: 3.66
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -2.44

References

1. Figuerola-Asencio L, Morales P, Zhao P, Hurst DP, Sayed SS, Colón KL, Gómez-Cañas M, Fernández-Ruiz J, Croatt MP, Reggio PH, Abood ME, Jagerovic N..  (2023)  Thienopyrimidine Derivatives as GPR55 Receptor Antagonists: Insight into Structure-Activity Relationship.,  14  (1.0): [PMID:36655130] [10.1021/acsmedchemlett.2c00325]

Source