The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
furan-2-yl(4-(2-(morpholinomethyl)-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl)methanone ID: ALA5281110
Max Phase: Preclinical
Molecular Formula: C24H29N5O3S
Molecular Weight: 467.60
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccco1)N1CCN(c2nc(CN3CCOCC3)nc3sc4c(c23)CCCC4)CC1
Standard InChI: InChI=1S/C24H29N5O3S/c30-24(18-5-3-13-32-18)29-9-7-28(8-10-29)22-21-17-4-1-2-6-19(17)33-23(21)26-20(25-22)16-27-11-14-31-15-12-27/h3,5,13H,1-2,4,6-12,14-16H2
Standard InChI Key: QEVUAKDVSVJAFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
-2.9934 2.7722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7494 2.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6689 1.6445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8517 1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4412 2.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6204 2.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2099 2.8819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2099 1.4600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3891 1.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0213 0.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3891 0.0382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2099 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6204 0.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0213 -0.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8191 -0.5919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2866 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9622 -1.9706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1613 -2.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3283 -2.7160 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.1074 -2.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8186 -2.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5297 -2.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5297 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8186 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1074 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3072 -1.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1075 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5180 -0.5271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1075 0.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5180 0.8946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3389 0.8946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7494 0.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3389 -0.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
4 5 2 0
5 1 1 0
6 5 1 0
6 7 2 0
8 6 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
14 11 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 1 0
20 25 2 0
25 26 1 0
26 14 1 0
26 18 2 0
16 27 1 0
27 28 1 0
29 28 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.60Molecular Weight (Monoisotopic): 467.1991AlogP: 2.96#Rotatable Bonds: 4Polar Surface Area: 74.94Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.75CX LogP: 3.66CX LogD: 3.66Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -2.44
References 1. Figuerola-Asencio L, Morales P, Zhao P, Hurst DP, Sayed SS, Colón KL, Gómez-Cañas M, Fernández-Ruiz J, Croatt MP, Reggio PH, Abood ME, Jagerovic N.. (2023) Thienopyrimidine Derivatives as GPR55 Receptor Antagonists: Insight into Structure-Activity Relationship., 14 (1.0): [PMID:36655130 ] [10.1021/acsmedchemlett.2c00325 ]