7-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methoxy]-1-methyl-9-propyl-pyrido[3,4-b]indole

ID: ALA5281126

Max Phase: Preclinical

Molecular Formula: C25H24ClN5O

Molecular Weight: 445.95

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCn1c2cc(OCc3cn(Cc4ccccc4Cl)nn3)ccc2c2ccnc(C)c21

Standard InChI:  InChI=1S/C25H24ClN5O/c1-3-12-31-24-13-20(8-9-21(24)22-10-11-27-17(2)25(22)31)32-16-19-15-30(29-28-19)14-18-6-4-5-7-23(18)26/h4-11,13,15H,3,12,14,16H2,1-2H3

Standard InChI Key:  BRKZBSHTYDDRHP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    1.1257    0.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8403    1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5522    0.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5522    0.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8421   -0.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1257    0.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3564    1.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8272    0.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3351   -0.1860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6871    1.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4886    1.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9594    1.2968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6287    0.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0314   -0.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4282   -0.3466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2693    0.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9668   -0.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5436   -0.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3216   -1.1725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5301   -1.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0509   -1.1472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8384   -1.3146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2409   -0.6174    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7022   -0.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9385   -0.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6360   -0.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6363   -1.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3321   -1.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0299   -1.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0314   -0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3366   -0.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3366    0.5924    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  7  8  2  0
  9  8  1  0
  4  9  1  0
  7 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 13 14  1  0
  6 15  1  0
 15 16  1  0
 16 17  1  0
  9 18  1  0
 18 19  1  0
 19 20  1  0
 21 17  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 17  2  0
 23 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281126

    ---

Associated Targets(Human)

MAOA Tclin Monoamine oxidase A (11911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.95Molecular Weight (Monoisotopic): 445.1669AlogP: 5.78#Rotatable Bonds: 7
Polar Surface Area: 57.76Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.04CX LogP: 5.13CX LogD: 5.11
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -1.38

References

1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R..  (2021)  β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy.,  64  (3.0): [PMID:33528252] [10.1021/acs.jmedchem.0c01887]

Source