The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methoxy]-1-methyl-9-propyl-pyrido[3,4-b]indole ID: ALA5281126
Max Phase: Preclinical
Molecular Formula: C25H24ClN5O
Molecular Weight: 445.95
Associated Items:
Names and Identifiers Canonical SMILES: CCCn1c2cc(OCc3cn(Cc4ccccc4Cl)nn3)ccc2c2ccnc(C)c21
Standard InChI: InChI=1S/C25H24ClN5O/c1-3-12-31-24-13-20(8-9-21(24)22-10-11-27-17(2)25(22)31)32-16-19-15-30(29-28-19)14-18-6-4-5-7-23(18)26/h4-11,13,15H,3,12,14,16H2,1-2H3
Standard InChI Key: BRKZBSHTYDDRHP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
1.1257 0.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8403 1.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5522 0.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5522 0.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8421 -0.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1257 0.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3564 1.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8272 0.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3351 -0.1860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6871 1.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4886 1.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9594 1.2968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6287 0.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0314 -0.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4282 -0.3466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2693 0.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9668 -0.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5436 -0.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3216 -1.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5301 -1.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0509 -1.1472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8384 -1.3146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2409 -0.6174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7022 -0.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9385 -0.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6360 -0.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6363 -1.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3321 -1.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0299 -1.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0314 -0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3366 -0.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3366 0.5924 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 2 0
9 8 1 0
4 9 1 0
7 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
13 14 1 0
6 15 1 0
15 16 1 0
16 17 1 0
9 18 1 0
18 19 1 0
19 20 1 0
21 17 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 17 2 0
23 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.95Molecular Weight (Monoisotopic): 445.1669AlogP: 5.78#Rotatable Bonds: 7Polar Surface Area: 57.76Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.04CX LogP: 5.13CX LogD: 5.11Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -1.38
References 1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R.. (2021) β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy., 64 (3.0): [PMID:33528252 ] [10.1021/acs.jmedchem.0c01887 ]