(4-((2-(4-bromo-3-fluorophenyl)-N-phenylacetamido)methyl)phenyl)sulfamic acid

ID: ALA5281135

Max Phase: Preclinical

Molecular Formula: C21H18BrFN2O4S

Molecular Weight: 493.35

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(Br)c(F)c1)N(Cc1ccc(NS(=O)(=O)O)cc1)c1ccccc1

Standard InChI:  InChI=1S/C21H18BrFN2O4S/c22-19-11-8-16(12-20(19)23)13-21(26)25(18-4-2-1-3-5-18)14-15-6-9-17(10-7-15)24-30(27,28)29/h1-12,24H,13-14H2,(H,27,28,29)

Standard InChI Key:  OKPKKOHGCUBJOI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    1.1319    0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4137    0.4164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2970    0.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0152    0.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0225   -0.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7407   -0.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4515   -0.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1696   -0.7891    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8804   -0.3702    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8730    0.4547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4441    0.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7259    0.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4063   -0.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3117   -0.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3191   -1.6396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3916   -2.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1097   -1.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1171   -0.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1392    1.6475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7057   -0.3702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0940   -1.1674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8466    0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5613    0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5615    1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2745    2.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9893    1.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9909    0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2791    0.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7041    2.0584    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    4.7057    0.4119    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 13 18  2  0
  1 19  2  0
  9 20  2  0
  9 21  2  0
  1 22  1  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 26 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281135

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.35Molecular Weight (Monoisotopic): 492.0155AlogP: 4.58#Rotatable Bonds: 7
Polar Surface Area: 86.71Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: -1.36CX Basic pKa: CX LogP: 4.04CX LogD: 1.66
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.56

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source