The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((2-(4-bromo-3-fluorophenyl)-N-phenylacetamido)methyl)phenyl)sulfamic acid ID: ALA5281135
Max Phase: Preclinical
Molecular Formula: C21H18BrFN2O4S
Molecular Weight: 493.35
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(Br)c(F)c1)N(Cc1ccc(NS(=O)(=O)O)cc1)c1ccccc1
Standard InChI: InChI=1S/C21H18BrFN2O4S/c22-19-11-8-16(12-20(19)23)13-21(26)25(18-4-2-1-3-5-18)14-15-6-9-17(10-7-15)24-30(27,28)29/h1-12,24H,13-14H2,(H,27,28,29)
Standard InChI Key: OKPKKOHGCUBJOI-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
1.1319 0.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4137 0.4164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2970 0.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0152 0.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0225 -0.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7407 -0.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4515 -0.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1696 -0.7891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8804 -0.3702 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.8730 0.4547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4441 0.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7259 0.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4063 -0.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3117 -0.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3191 -1.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3916 -2.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1097 -1.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1171 -0.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1392 1.6475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7057 -0.3702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0940 -1.1674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8466 0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5613 0.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5615 1.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2745 2.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9893 1.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9909 0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2791 0.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7041 2.0584 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
4.7057 0.4119 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
7 6 1 0
7 8 1 0
9 8 1 0
9 10 1 0
7 11 2 0
11 12 1 0
12 4 2 0
13 2 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
13 18 2 0
1 19 2 0
9 20 2 0
9 21 2 0
1 22 1 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
26 29 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.35Molecular Weight (Monoisotopic): 492.0155AlogP: 4.58#Rotatable Bonds: 7Polar Surface Area: 86.71Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: -1.36CX Basic pKa: ┄CX LogP: 4.04CX LogD: 1.66Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.56
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]