N-(4-((7-(3,4-dimethylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino)phenyl)acetamide

ID: ALA5281250

Max Phase: Preclinical

Molecular Formula: C22H21N5O

Molecular Weight: 371.44

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc(Nc2ncnc3c2ccn3-c2ccc(C)c(C)c2)cc1

Standard InChI:  InChI=1S/C22H21N5O/c1-14-4-9-19(12-15(14)2)27-11-10-20-21(23-13-24-22(20)27)26-18-7-5-17(6-8-18)25-16(3)28/h4-13H,1-3H3,(H,25,28)(H,23,24,26)

Standard InChI Key:  PKZFLZPUFVUWSV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    3.3534    3.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0608    3.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3534    2.3912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6176    3.6646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8818    3.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8818    2.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1460    1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4103    2.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4103    3.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1460    3.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3254    1.9667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3254    1.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0611    0.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0611   -0.1555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3254   -0.5800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4103   -0.1555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4103    0.6932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8818   -0.4386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3912    0.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8818    0.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1365   -1.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9855   -1.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2402   -2.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6741   -2.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8252   -2.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5705   -1.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9288   -3.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0608   -2.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  8 11  1  0
 11 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 12 17  1  0
 16 17  2  0
 14 18  1  0
 18 19  1  0
 20 19  2  0
 13 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 24 27  1  0
 23 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281250

    ---

Associated Targets(Human)

PIP4K2A Tbio Phosphatidylinositol-5-phosphate 4-kinase type-2 alpha (1501 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CG Tclin PI3-kinase p110-gamma subunit (5411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.44Molecular Weight (Monoisotopic): 371.1746AlogP: 4.74#Rotatable Bonds: 4
Polar Surface Area: 71.84Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.82CX LogP: 4.70CX LogD: 4.70
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -1.47

References

1. Willems HMG, Edwards S, Boffey HK, Chawner SJ, Green C, Romero T, Winpenny D, Skidmore J, Clarke JH, Andrews SP..  (2023)  Identification of ARUK2002821 as an isoform-selective PI5P4Kα inhibitor.,  14  (5): [PMID:37252102] [10.1039/d3md00039g]

Source