Oscillatoxin E

ID: ALA5281256

Max Phase: Preclinical

Molecular Formula: C33H45BrO8

Molecular Weight: 649.62

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H](CC[C@H](C)[C@H]1OC2=C(/C(=C/C(=O)O[C@@H]3CC(=O)O[C@@H]3C)[C@H](C)CC2(C)C)[C@H](OC)[C@@H]1C)c1cc(O)ccc1Br

Standard InChI:  InChI=1S/C33H45BrO8/c1-17(9-12-25(38-7)23-13-21(35)10-11-24(23)34)30-19(3)31(39-8)29-22(18(2)16-33(5,6)32(29)42-30)14-27(36)41-26-15-28(37)40-20(26)4/h10-11,13-14,17-20,25-26,30-31,35H,9,12,15-16H2,1-8H3/b22-14+/t17-,18+,19+,20+,25-,26+,30+,31+/m0/s1

Standard InChI Key:  SXZAPDMYMYDYSU-FSGUNDMBSA-N

Molfile:  

 
     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
   -4.7522   -1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0847   -0.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3396    0.1149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1646    0.1149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4195   -0.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2165   -0.8832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9271    0.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2878   -0.8832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7043   -0.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9073   -0.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3239    0.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5374    0.8670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9540    1.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1570    1.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0565    0.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5269   -0.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3133   -0.9404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4835   -1.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0670   -0.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8534    0.2263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8640   -0.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4474   -0.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2444   -0.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8279    0.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6249   -0.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2086    0.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0029    0.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2165   -0.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6371   -1.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8394   -0.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8506   -1.8506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9950    1.3359    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    3.6143    0.9661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8173    1.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0776   -1.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6971   -1.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8967   -1.5239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6938   -1.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6696    1.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2563    1.9510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3344    1.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9178    0.4972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6504    0.0127    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  5  1  0
  5  6  2  0
  3  7  1  6
  2  8  1  6
  8  9  1  0
  9 10  1  0
 10 11  2  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 29 31  1  0
 26 32  1  0
 24 33  1  6
 33 34  1  0
 21 35  1  6
 18 36  1  1
 17 37  1  1
 37 38  1  0
 14 39  1  0
 14 40  1  0
 12 41  1  6
  9 42  2  0
 19 43  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5281256

    ---

Associated Targets(non-human)

Nitzschia amabilis (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 649.62Molecular Weight (Monoisotopic): 648.2298AlogP: 6.80#Rotatable Bonds: 9
Polar Surface Area: 100.52Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.92CX Basic pKa: CX LogP: 6.21CX LogD: 6.20
Aromatic Rings: 1Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: 1.46

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source