The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-((2-(4,5-dibromo-1H-pyrrole-2-carboxamido)-3-(4-hydroxyphenyl)propanamido)methyl)benzoic acid ID: ALA5281268
Max Phase: Preclinical
Molecular Formula: C22H19Br2N3O5
Molecular Weight: 565.22
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(CNC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)c2cc(Br)c(Br)[nH]2)cc1
Standard InChI: InChI=1S/C22H19Br2N3O5/c23-16-10-18(26-19(16)24)21(30)27-17(9-12-3-7-15(28)8-4-12)20(29)25-11-13-1-5-14(6-2-13)22(31)32/h1-8,10,17,26,28H,9,11H2,(H,25,29)(H,27,30)(H,31,32)/t17-/m0/s1
Standard InChI Key: NPFVTDFFMCQGEY-KRWDZBQOSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-1.0734 0.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0734 -0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7849 -0.5889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4964 -0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2079 -0.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2938 -1.4057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0971 -1.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5077 -0.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9582 -0.2551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.3292 -0.8651 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-4.5079 -2.2881 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.4964 0.6432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3618 -0.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3497 -0.1783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3618 -1.4108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0612 -0.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7728 -0.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7730 0.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4828 1.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1945 0.6412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1961 -0.1762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4874 -0.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9061 1.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9061 1.8737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6177 0.6412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3618 1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3616 1.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3482 2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0599 1.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0615 1.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3527 0.6449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7714 2.2879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 1 0
6 5 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
7 11 1 0
4 12 2 0
2 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
20 23 1 0
23 24 2 0
23 25 1 0
1 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.22Molecular Weight (Monoisotopic): 562.9691AlogP: 3.60#Rotatable Bonds: 8Polar Surface Area: 131.52Molecular Species: ACIDHBA: 4HBD: 5#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.07CX Basic pKa: ┄CX LogP: 3.48CX LogD: 0.36Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -0.02