The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isopropyl-2-((3-(4-(dimethylamino)but-2-enamido)phenyl)(2-(piperidin-1-yl)ethoxy)methyl)-1H-pyrrolo[3,2-b]pyridine-7-carboxylate ID: ALA5281316
Max Phase: Preclinical
Molecular Formula: C31H41N5O4
Molecular Weight: 547.70
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)c1ccnc2cc(C(OCCN3CCCCC3)c3cccc(NC(=O)/C=C/CN(C)C)c3)[nH]c12
Standard InChI: InChI=1S/C31H41N5O4/c1-22(2)40-31(38)25-13-14-32-26-21-27(34-29(25)26)30(39-19-18-36-16-6-5-7-17-36)23-10-8-11-24(20-23)33-28(37)12-9-15-35(3)4/h8-14,20-22,30,34H,5-7,15-19H2,1-4H3,(H,33,37)/b12-9+
Standard InChI Key: MQPYAXPCLQILKZ-FMIVXFBMSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
-0.8077 2.1802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3952 1.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8077 0.7511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4297 1.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7602 2.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5574 2.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0318 1.6323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6999 0.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0320 0.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4277 -0.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 -0.0074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8986 0.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4277 -1.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1422 -1.6575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8567 -1.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5712 -1.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 -1.2450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0002 -1.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7148 -1.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7148 -0.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0002 -0.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 -0.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 -1.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 -2.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0030 -2.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7134 -2.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7134 -1.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0012 -1.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4279 -1.2454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1424 -1.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1424 -2.4830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8570 -1.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5714 -1.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2860 -1.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0003 -1.6578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7148 -1.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0003 -2.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6328 2.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0453 2.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0453 1.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
4 2 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
9 8 1 0
10 9 2 0
11 10 1 0
11 12 1 0
12 4 1 0
12 8 2 0
13 10 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 17 1 0
23 13 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
29 27 1 0
30 29 1 0
30 31 2 0
32 30 1 0
33 32 2 0
34 33 1 0
35 34 1 0
35 36 1 0
35 37 1 0
1 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.70Molecular Weight (Monoisotopic): 547.3159AlogP: 4.78#Rotatable Bonds: 12Polar Surface Area: 99.79Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.41CX Basic pKa: 9.06CX LogP: 4.27CX LogD: 1.53Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.89
References 1. Yang GJ, Wu J, Miao L, Zhu MH, Zhou QJ, Lu XJ, Lu JF, Leung CH, Ma DL, Chen J.. (2021) Pharmacological inhibition of KDM5A for cancer treatment., 226 [PMID:34555614 ] [10.1016/j.ejmech.2021.113855 ]