The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
14-(quinoxalin-6-yl)-7,8,13b,14-tetrahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(13H)-one ID: ALA5281324
Max Phase: Preclinical
Molecular Formula: C26H19N5O
Molecular Weight: 417.47
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccccc2N(c2ccc3nccnc3c2)C2c3[nH]c4ccccc4c3CCN12
Standard InChI: InChI=1S/C26H19N5O/c32-26-19-6-2-4-8-23(19)31(16-9-10-21-22(15-16)28-13-12-27-21)25-24-18(11-14-30(25)26)17-5-1-3-7-20(17)29-24/h1-10,12-13,15,25,29H,11,14H2
Standard InChI Key: OUQVSVUXTWMTOC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 38 0 0 0 0 0 0 0 0999 V2000
-3.2308 1.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5162 2.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8044 1.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8044 0.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5144 0.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2308 0.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0196 0.5885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5346 1.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0196 1.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6838 2.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1367 2.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6217 2.0960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2860 1.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7709 0.6745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5916 0.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9274 1.5145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4424 2.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8550 2.8968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7455 1.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2308 0.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8985 0.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0789 0.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3584 -0.0400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7708 -0.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3588 -1.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4666 -1.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8785 -0.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4703 -0.0400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7698 -2.1798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -2.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4640 -2.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8808 -2.1849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
8 7 1 0
9 8 2 0
3 9 1 0
9 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 1 0
17 18 2 0
16 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
15 22 1 0
23 14 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
25 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
26 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.47Molecular Weight (Monoisotopic): 417.1590AlogP: 4.96#Rotatable Bonds: 1Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.76CX LogP: 4.20CX LogD: 4.20Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -0.41
References 1. Hao X, Deng J, Zhang H, Liang Z, Lei F, Wang Y, Yang X, Wang Z.. (2021) Design, synthesis and bioactivity evaluation of novel N-phenyl-substituted evodiamine derivatives as potent anti-tumor agents., 55 [PMID:34990980 ] [10.1016/j.bmc.2021.116595 ]