The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(3,5-dimethoxystyryl)phenyl)-2-((5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl)thio)acetamide ID: ALA5281338
Max Phase: Preclinical
Molecular Formula: C27H25N3O5S
Molecular Weight: 503.58
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nnc(SCC(=O)Nc3ccc(/C=C/c4cc(OC)cc(OC)c4)cc3)o2)cc1
Standard InChI: InChI=1S/C27H25N3O5S/c1-32-22-12-8-20(9-13-22)26-29-30-27(35-26)36-17-25(31)28-21-10-6-18(7-11-21)4-5-19-14-23(33-2)16-24(15-19)34-3/h4-16H,17H2,1-3H3,(H,28,31)/b5-4+
Standard InChI Key: NHRPARWJFHYJSC-SNAWJCMRSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-6.4367 -0.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7221 0.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0102 -0.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0102 -0.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7203 -1.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4367 -0.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1513 0.3293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1513 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7203 -2.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0057 -2.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2956 0.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5809 -0.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8663 0.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8661 1.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1532 1.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4383 1.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4368 0.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1486 -0.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7238 1.5655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0091 1.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7055 1.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0091 0.3277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4201 1.1529 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1347 1.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2209 2.3858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0277 2.5573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4401 1.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8882 1.2300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2653 1.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6781 2.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5008 2.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9135 1.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5044 1.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6797 1.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7388 1.8419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1513 2.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
3 11 1 0
11 12 2 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
25 24 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
27 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
32 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.58Molecular Weight (Monoisotopic): 503.1515AlogP: 5.66#Rotatable Bonds: 10Polar Surface Area: 95.71Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.68CX Basic pKa: ┄CX LogP: 4.76CX LogD: 4.76Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.22Np Likeness Score: -1.33
References 1. Ahmadi R, Ebrahimzadeh MA.. (2020) Resveratrol - A comprehensive review of recent advances in anticancer drug design and development., 200 [PMID:32485531 ] [10.1016/j.ejmech.2020.112356 ]