(R)-6-(1-amino-4-methylpentan-2-yl)-3-(pyridin-3-yl)-5,6-dihydrothieno[2,3-c]pyridin-7(4H)-one

ID: ALA5281395

Max Phase: Preclinical

Molecular Formula: C18H23N3OS

Molecular Weight: 329.47

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](CN)N1CCc2c(-c3cccnc3)csc2C1=O

Standard InChI:  InChI=1S/C18H23N3OS/c1-12(2)8-14(9-19)21-7-5-15-16(11-23-17(15)18(21)22)13-4-3-6-20-10-13/h3-4,6,10-12,14H,5,7-9,19H2,1-2H3/t14-/m1/s1

Standard InChI Key:  QWOFHSCQDREXBV-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -0.2842   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2842   -0.9102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4277   -1.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1443   -0.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1398   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4277    0.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9195    0.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4059   -0.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9267   -1.1560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1330    0.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5498    1.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7635    2.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5606    2.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1421    1.9817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9332    1.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4282   -2.1435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9981   -1.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7132   -0.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9981   -2.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7125   -2.5611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4270   -1.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1421   -0.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4270   -2.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  2  0
  5  6  1  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  1  0
 10  7  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
  3 16  2  0
  2 17  1  0
 17 18  1  0
 17 19  1  1
 19 20  1  0
 21 18  1  0
 21 22  1  0
 21 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281395

    ---

Associated Targets(Human)

DHPS Tchem Deoxyhypusine synthase (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 329.47Molecular Weight (Monoisotopic): 329.1562AlogP: 3.18#Rotatable Bonds: 5
Polar Surface Area: 59.22Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.18CX LogP: 2.53CX LogD: 0.77
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.92Np Likeness Score: -0.81

References

1. Tanaka Y, Kurasawa O, Yokota A, Klein MG, Saito B, Matsumoto S, Okaniwa M, Ambrus-Aikelin G, Uchiyama N, Morishita D, Kimura H, Imamura S..  (2020)  New Series of Potent Allosteric Inhibitors of Deoxyhypusine Synthase.,  11  (8.0): [PMID:34345355] [10.1021/acsmedchemlett.0c00331]

Source