The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Oxepeucedanin methanolate ID: ALA5281403
Max Phase: Preclinical
Molecular Formula: C17H18O6
Molecular Weight: 318.33
Associated Items:
Names and Identifiers Canonical SMILES: COC(C)(C)C(O)COc1c2ccoc2cc2oc(=O)ccc12
Standard InChI: InChI=1S/C17H18O6/c1-17(2,20-3)14(18)9-22-16-10-4-5-15(19)23-13(10)8-12-11(16)6-7-21-12/h4-8,14,18H,9H2,1-3H3
Standard InChI Key: UHENVVIVPZCJOA-UHFFFAOYSA-N
Molfile:
RDKit 2D
23 25 0 0 0 0 0 0 0 0999 V2000
1.7034 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7034 -1.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9884 -0.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2735 -1.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2735 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9884 -2.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4440 -2.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1555 -2.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1555 -1.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4389 -0.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4185 -2.4203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9361 -0.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9361 -2.2585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4185 -1.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4389 0.0538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2760 0.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2760 1.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9911 1.7051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4389 1.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1540 1.2923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0253 2.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8509 2.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1540 0.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
4 10 1 0
1 11 2 0
9 12 1 0
8 13 1 0
13 14 1 0
14 12 2 0
10 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
19 20 1 0
19 21 1 0
19 22 1 0
20 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 318.33Molecular Weight (Monoisotopic): 318.1103AlogP: 2.70#Rotatable Bonds: 5Polar Surface Area: 82.04Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.23CX Basic pKa: ┄CX LogP: 1.80CX LogD: 1.80Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.73Np Likeness Score: 1.58