N-benzyl-N-methyl-2-((1-methyl-1H-pyrazol-5-yl)(thiophen-2-yl)methoxy)ethan-1-amine

ID: ALA5281430

Max Phase: Preclinical

Molecular Formula: C19H23N3OS

Molecular Weight: 341.48

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(CCOC(c1cccs1)c1ccnn1C)Cc1ccccc1

Standard InChI:  InChI=1S/C19H23N3OS/c1-21(15-16-7-4-3-5-8-16)12-13-23-19(18-9-6-14-24-18)17-10-11-20-22(17)2/h3-11,14,19H,12-13,15H2,1-2H3

Standard InChI Key:  BFBXGOCDVLAVMA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    2.0833   -0.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7979   -0.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5098   -0.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5098   -1.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7997   -1.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0833   -1.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3687   -0.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3687    0.5349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6541    0.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0833    0.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0605    0.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7751    0.9475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4897    0.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2044    0.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4897   -0.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9578    0.6120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5098    1.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0973    1.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2906    1.7678    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8225   -0.7749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0773   -1.5594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9022   -1.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1570   -0.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0259   -0.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 16 14  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 14  1  0
 20 15  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 15  2  0
 20 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281430

    ---

Associated Targets(Human)

OPRM1 Tclin Mu opioid receptor (19785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SIGMAR1 Tclin Sigma opioid receptor (6358 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 341.48Molecular Weight (Monoisotopic): 341.1562AlogP: 3.72#Rotatable Bonds: 8
Polar Surface Area: 30.29Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.55CX LogP: 3.64CX LogD: 2.46
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.63Np Likeness Score: -1.90

References

1. Zhuang T, Xiong J, Hao S, Du W, Liu Z, Liu B, Zhang G, Chen Y..  (2021)  Bifunctional μ opioid and σ1 receptor ligands as novel analgesics with reduced side effects.,  223  [PMID:34175542] [10.1016/j.ejmech.2021.113658]

Source