(S)-(4-((2-((methoxycarbonyl)amino)-3-phenyl-N-(4-phenylthiazol-2-yl)propanamido)methyl)phenyl)sulfamic acid

ID: ALA5281432

Max Phase: Preclinical

Molecular Formula: C27H26N4O6S2

Molecular Weight: 566.66

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)N[C@@H](Cc1ccccc1)C(=O)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2ccccc2)cs1

Standard InChI:  InChI=1S/C27H26N4O6S2/c1-37-27(33)29-23(16-19-8-4-2-5-9-19)25(32)31(17-20-12-14-22(15-13-20)30-39(34,35)36)26-28-24(18-38-26)21-10-6-3-7-11-21/h2-15,18,23,30H,16-17H2,1H3,(H,29,33)(H,34,35,36)/t23-/m0/s1

Standard InChI Key:  JGFPNEFTGVMQEB-QHCPKHFHSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    1.8467    1.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1286    0.6998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4177    1.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3003    0.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3077   -0.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0259   -0.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7366   -0.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4548   -0.5057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1655   -0.0869    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1582    0.7380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7292    0.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0111    1.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1212   -0.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8540    1.9309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9908   -0.0869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3791   -0.8840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614    0.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8321   -0.5441    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6394   -1.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8371   -1.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5118   -0.6748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4244   -2.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8369   -2.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4249   -3.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4006   -3.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8125   -2.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4043   -2.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761    1.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761    1.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761   -0.5446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614   -0.1320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9907    2.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9899    3.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2750    3.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5631    3.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5583    2.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761   -1.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9908   -1.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9908   -0.1320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  1 14  2  0
  9 15  2  0
  9 16  2  0
  1 17  1  0
 18 13  1  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 13 21  2  0
 20 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 28 17  1  0
 29 28  1  0
 31 30  1  0
 17 31  1  6
 32 29  2  0
 33 32  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 29 36  1  0
 30 37  1  0
 37 38  1  0
 30 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5281432

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 566.66Molecular Weight (Monoisotopic): 566.1294AlogP: 4.53#Rotatable Bonds: 10
Polar Surface Area: 137.93Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: -1.72CX Basic pKa: CX LogP: 2.89CX LogD: 2.03
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -1.20

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source