(2S,3S,4S,5R,6S)-6-(4-carboxy-3-pentadecylphenoxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylic acid

ID: ALA5281456

Max Phase: Preclinical

Molecular Formula: C28H44O9

Molecular Weight: 524.65

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCc1cc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)ccc1C(=O)O

Standard InChI:  InChI=1S/C28H44O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-18-20(16-17-21(19)26(32)33)36-28-24(31)22(29)23(30)25(37-28)27(34)35/h16-18,22-25,28-31H,2-15H2,1H3,(H,32,33)(H,34,35)/t22-,23-,24+,25-,28+/m0/s1

Standard InChI Key:  XLAJOEFINXQNHO-CPIYQPHESA-N

Molfile:  

 
     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   -4.7209    1.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0083    2.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2660    1.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2660    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0083    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7209    0.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4632    0.4157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4632   -0.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7209   -0.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7209   -1.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4632   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2055   -1.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2055   -0.8313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9181   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6604   -1.6924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9181   -2.9394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4632   -2.9394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0083   -2.1080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0083   -0.4156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5534    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8112    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0986    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3562    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3562    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0986    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8112    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5534    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2957    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0083    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7506    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4632    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2055    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9181    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6604    0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5534    2.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5534    2.9394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8112    1.6924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  1
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
 12 14  1  1
 14 15  1  0
 14 16  2  0
 11 17  1  6
 10 18  1  1
  9 19  1  6
  4 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
  3 35  1  0
 35 36  2  0
 35 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281456

    ---

Associated Targets(Human)

HPSE Tchem Heparanase (634 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.65Molecular Weight (Monoisotopic): 524.2985AlogP: 4.29#Rotatable Bonds: 18
Polar Surface Area: 153.75Molecular Species: ACIDHBA: 7HBD: 5
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.07CX Basic pKa: CX LogP: 6.12CX LogD: -0.41
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: 0.93

References

1. Imai Y, Wakasugi D, Suzuki R, Kato S, Sugisaki M, Mima M, Miyagawa H, Endo M, Fujimoto N, Fukunaga T, Kato S, Kuroda S, Takahashi T, Kakinuma H..  (2023)  Lead identification of novel tetrahydroimidazo[1,2-a]pyridine-5-carboxylic acid derivative as a potent heparanase-1 inhibitor.,  79  [PMID:36368497] [10.1016/j.bmcl.2022.129050]

Source