The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S,4S,5R,6S)-6-(4-carboxy-3-pentadecylphenoxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylic acid ID: ALA5281456
Max Phase: Preclinical
Molecular Formula: C28H44O9
Molecular Weight: 524.65
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCCCc1cc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)ccc1C(=O)O
Standard InChI: InChI=1S/C28H44O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-18-20(16-17-21(19)26(32)33)36-28-24(31)22(29)23(30)25(37-28)27(34)35/h16-18,22-25,28-31H,2-15H2,1H3,(H,32,33)(H,34,35)/t22-,23-,24+,25-,28+/m0/s1
Standard InChI Key: XLAJOEFINXQNHO-CPIYQPHESA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
-4.7209 1.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0083 2.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2660 1.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2660 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0083 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7209 0.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4632 0.4157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4632 -0.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7209 -0.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7209 -1.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4632 -2.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2055 -1.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2055 -0.8313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.9181 -2.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6604 -1.6924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.9181 -2.9394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4632 -2.9394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0083 -2.1080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0083 -0.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5534 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8112 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0986 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3562 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3562 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0986 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8112 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5534 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2957 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0083 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7506 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4632 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2055 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9181 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6604 0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5534 2.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5534 2.9394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8112 1.6924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
8 7 1 1
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
12 14 1 1
14 15 1 0
14 16 2 0
11 17 1 6
10 18 1 1
9 19 1 6
4 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
3 35 1 0
35 36 2 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.65Molecular Weight (Monoisotopic): 524.2985AlogP: 4.29#Rotatable Bonds: 18Polar Surface Area: 153.75Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.07CX Basic pKa: ┄CX LogP: 6.12CX LogD: -0.41Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: 0.93
References 1. Imai Y, Wakasugi D, Suzuki R, Kato S, Sugisaki M, Mima M, Miyagawa H, Endo M, Fujimoto N, Fukunaga T, Kato S, Kuroda S, Takahashi T, Kakinuma H.. (2023) Lead identification of novel tetrahydroimidazo[1,2-a]pyridine-5-carboxylic acid derivative as a potent heparanase-1 inhibitor., 79 [PMID:36368497 ] [10.1016/j.bmcl.2022.129050 ]