3-hydroxy-6-methyl-2-((4-propylpiperidin-1-yl)methyl)-4H-pyran-4-one

ID: ALA5281507

Max Phase: Preclinical

Molecular Formula: C15H23NO3

Molecular Weight: 265.35

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC1CCN(Cc2oc(C)cc(=O)c2O)CC1

Standard InChI:  InChI=1S/C15H23NO3/c1-3-4-12-5-7-16(8-6-12)10-14-15(18)13(17)9-11(2)19-14/h9,12,18H,3-8,10H2,1-2H3

Standard InChI Key:  ZYHUMROYBCXZOK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   -0.3575    3.5072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575    2.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    2.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0725    2.6822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0725    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0725    0.2071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574   -1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0725   -1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7875   -1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7875   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0725   -2.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7876   -2.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7876   -3.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575    1.0321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0725    1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7876    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0725    2.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  3  4  1  0
  5  3  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 16  5  1  0
 17 16  1  0
 17 18  1  0
 19 17  2  0
 19  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281507

    ---

Associated Targets(non-human)

Mycolicibacterium smegmatis (8003 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 265.35Molecular Weight (Monoisotopic): 265.1678AlogP: 2.67#Rotatable Bonds: 4
Polar Surface Area: 53.68Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.49CX Basic pKa: 7.24CX LogP: 2.44CX LogD: 2.19
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.91Np Likeness Score: 0.00

References

1. He M, Fan M, Peng Z, Wang G..  (2021)  An overview of hydroxypyranone and hydroxypyridinone as privileged scaffolds for novel drug discovery.,  221  [PMID:34023737] [10.1016/j.ejmech.2021.113546]

Source