The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5281543
Max Phase: Preclinical
Molecular Formula: C30H42Cl2N3O4P
Molecular Weight: 610.56
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1P(=O)(Oc1ccc4ccccc4c1)N(CCCl)CCCl)[C@@H]23
Standard InChI: InChI=1S/C30H42Cl2N3O4P/c1-38-29(36)12-4-11-28-27-10-6-18-33-17-5-9-25(30(27)33)22-35(28)40(37,34(19-15-31)20-16-32)39-26-14-13-23-7-2-3-8-24(23)21-26/h2-3,7-8,13-14,21,25,27-28,30H,4-6,9-12,15-20,22H2,1H3/t25-,27+,28+,30-,40?/m0/s1
Standard InChI Key: RNNIOTANCGVGJT-JXPGPEBHSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
-1.0720 -1.0336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3533 -1.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3659 -2.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3484 -2.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3484 -3.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3659 -3.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0802 -3.5068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0802 -2.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7947 -2.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7947 -1.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5091 -2.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5091 -3.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7947 -3.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7947 -3.0931 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.0844 -1.8524 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.3700 -3.1057 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3610 -1.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 -0.2064 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-0.3533 -0.6200 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.0722 -1.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7936 -1.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5048 -1.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2262 -1.0731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5048 -2.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9374 -1.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7883 0.2072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7883 1.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3557 0.2072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 0.6207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5047 -0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2211 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9374 -0.2064 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.5047 1.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5047 2.2751 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.3557 1.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 1.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 2.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3546 2.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3589 2.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3637 1.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3557 3.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3563 3.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0672 3.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0738 2.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 3 1 0
8 9 1 0
9 10 1 0
10 1 1 0
11 9 1 0
12 11 1 0
13 12 1 0
7 13 1 0
9 14 1 6
8 15 1 6
3 16 1 6
17 2 1 0
18 1 1 0
2 19 1 1
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
18 26 1 0
26 27 1 0
18 28 1 0
18 29 2 0
26 30 1 0
30 31 1 0
31 32 1 0
27 33 1 0
33 34 1 0
28 35 1 0
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
40 39 2 0
35 40 1 0
38 41 1 0
42 41 2 0
43 42 1 0
44 43 2 0
39 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 610.56Molecular Weight (Monoisotopic): 609.2290AlogP: 6.62#Rotatable Bonds: 12Polar Surface Area: 62.32Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.41CX LogP: 4.66CX LogD: 2.66Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.15Np Likeness Score: 0.40
References 1. Li Y, Wang G, Liu J, Ouyang L.. (2020) Quinolizidine alkaloids derivatives from Sophora alopecuroides Linn: Bioactivities, structure-activity relationships and preliminary molecular mechanisms., 188 [PMID:31884408 ] [10.1016/j.ejmech.2019.111972 ]