The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-cyano-2-((Z)-3-ethyl-4-oxo-5-(((3-(2-(pyrrolidin-1-yl)ethyl)phenyl)amino)methylene)thiazolidin-2-ylidene)-N-(trifluoromethyl)acetamide ID: ALA5281562
Max Phase: Preclinical
Molecular Formula: C22H24F3N5O2S
Molecular Weight: 479.53
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(=O)/c(=C/Nc2cccc(CCN3CCCC3)c2)s/c1=C(\C#N)C(=O)NC(F)(F)F
Standard InChI: InChI=1S/C22H24F3N5O2S/c1-2-30-20(32)18(33-21(30)17(13-26)19(31)28-22(23,24)25)14-27-16-7-5-6-15(12-16)8-11-29-9-3-4-10-29/h5-7,12,14,27H,2-4,8-11H2,1H3,(H,28,31)/b18-14-,21-17+
Standard InChI Key: JINUYEMGHKIEKW-ADDAYVOGSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
4.4252 1.1247 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8398 0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2501 1.1272 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7030 0.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3404 -0.4732 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.0307 -0.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8189 0.7673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9998 0.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5533 1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0903 -0.1661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3049 -0.9586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0985 -1.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6763 -0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4691 -0.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6844 -1.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1004 -2.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3098 -1.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0479 -0.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8416 -0.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4203 0.1592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2938 0.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0241 1.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6064 0.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2359 0.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3355 1.4054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0410 2.1717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7963 -0.3248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9226 -1.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4357 0.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2015 -0.1061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3095 1.0013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0485 -1.9443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6064 0.1124 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 2 0
4 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
14 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
7 25 1 0
25 26 1 0
6 27 2 0
27 28 1 0
27 29 1 0
29 30 1 0
30 2 1 0
29 31 2 0
28 32 3 0
2 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.53Molecular Weight (Monoisotopic): 479.1603AlogP: 1.73#Rotatable Bonds: 7Polar Surface Area: 90.16Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.40CX Basic pKa: 9.62CX LogP: 2.33CX LogD: 1.38Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.59Np Likeness Score: -1.57