The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzyl ((S)-5-((2R,3S)-3-(N-hydroxyformamido)-2-isobutylhexanamido)-6-oxo-6-(thiazol-2-ylamino)hexyl)carbamate ID: ALA5281591
Max Phase: Preclinical
Molecular Formula: C28H41N5O6S
Molecular Weight: 575.73
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@@H]([C@@H](CC(C)C)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)Nc1nccs1)N(O)C=O
Standard InChI: InChI=1S/C28H41N5O6S/c1-4-10-24(33(38)19-34)22(17-20(2)3)25(35)31-23(26(36)32-27-29-15-16-40-27)13-8-9-14-30-28(37)39-18-21-11-6-5-7-12-21/h5-7,11-12,15-16,19-20,22-24,38H,4,8-10,13-14,17-18H2,1-3H3,(H,30,37)(H,31,35)(H,29,32,36)/t22-,23+,24+/m1/s1
Standard InChI Key: SKJLITFHSZNZMQ-SGNDLWITSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
-2.1438 2.3912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4292 2.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4292 3.6280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1438 4.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2263 4.8649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0234 5.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4357 4.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8859 3.7105 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7146 2.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.8035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 2.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 1.5666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 2.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1438 2.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8584 2.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5730 2.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2877 2.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1438 1.5666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 1.1543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8584 1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8584 0.3298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 3.6280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 4.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 4.8649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.6280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7146 1.5666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4292 1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4292 0.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1438 -0.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1438 -0.9070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8585 -1.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8585 -2.1438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5731 -2.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5731 -3.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2877 -3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2877 -4.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5731 -5.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8585 -4.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8585 -3.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5731 -0.9070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 2 0
6 5 1 0
7 6 2 0
8 7 1 0
4 8 1 0
9 2 1 0
9 10 1 1
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
14 18 1 6
18 19 1 0
18 20 1 0
20 21 2 0
13 22 1 6
22 23 1 0
23 24 1 0
23 25 1 0
26 9 1 0
27 26 1 0
28 27 1 0
29 28 1 0
30 29 1 0
31 30 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
34 39 2 0
40 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.73Molecular Weight (Monoisotopic): 575.2778AlogP: 4.34#Rotatable Bonds: 18Polar Surface Area: 149.96Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.66CX Basic pKa: 0.06CX LogP: 4.23CX LogD: 4.03Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.09Np Likeness Score: -0.62
References 1. Xiu S, Dick A, Ju H, Mirzaie S, Abdi F, Cocklin S, Zhan P, Liu X.. (2020) Inhibitors of SARS-CoV-2 Entry: Current and Future Opportunities., 63 (21.0): [PMID:32539378 ] [10.1021/acs.jmedchem.0c00502 ]