benzyl ((S)-5-((2R,3S)-3-(N-hydroxyformamido)-2-isobutylhexanamido)-6-oxo-6-(thiazol-2-ylamino)hexyl)carbamate

ID: ALA5281591

Max Phase: Preclinical

Molecular Formula: C28H41N5O6S

Molecular Weight: 575.73

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC[C@@H]([C@@H](CC(C)C)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)Nc1nccs1)N(O)C=O

Standard InChI:  InChI=1S/C28H41N5O6S/c1-4-10-24(33(38)19-34)22(17-20(2)3)25(35)31-23(26(36)32-27-29-15-16-40-27)13-8-9-14-30-28(37)39-18-21-11-6-5-7-12-21/h5-7,11-12,15-16,19-20,22-24,38H,4,8-10,13-14,17-18H2,1-3H3,(H,30,37)(H,31,35)(H,29,32,36)/t22-,23+,24+/m1/s1

Standard InChI Key:  SKJLITFHSZNZMQ-SGNDLWITSA-N

Molfile:  

 
     RDKit          2D

 40 41  0  0  0  0  0  0  0  0999 V2000
   -2.1438    2.3912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292    2.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292    3.6280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1438    4.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2263    4.8649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0234    5.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4357    4.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8859    3.7105    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7146    2.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.8035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.5666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4291    2.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438    2.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584    2.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5730    2.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2877    2.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438    1.5666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4291    1.1543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584    1.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8584    0.3298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4291    3.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7146    1.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292    1.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292    0.3298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1438   -0.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1438   -0.9070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8585   -1.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8585   -2.1438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5731   -2.5561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5731   -3.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2877   -3.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2877   -4.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5731   -5.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8585   -4.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8585   -3.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5731   -0.9070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  4  8  1  0
  9  2  1  0
  9 10  1  1
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 14 18  1  6
 18 19  1  0
 18 20  1  0
 20 21  2  0
 13 22  1  6
 22 23  1  0
 23 24  1  0
 23 25  1  0
 26  9  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 36 35  2  0
 37 36  1  0
 38 37  2  0
 39 38  1  0
 34 39  2  0
 40 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5281591

    ---

Associated Targets(Human)

ACE2 Tchem Angiotensin-converting enzyme 2 (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 575.73Molecular Weight (Monoisotopic): 575.2778AlogP: 4.34#Rotatable Bonds: 18
Polar Surface Area: 149.96Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.66CX Basic pKa: 0.06CX LogP: 4.23CX LogD: 4.03
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.09Np Likeness Score: -0.62

References

1. Xiu S, Dick A, Ju H, Mirzaie S, Abdi F, Cocklin S, Zhan P, Liu X..  (2020)  Inhibitors of SARS-CoV-2 Entry: Current and Future Opportunities.,  63  (21.0): [PMID:32539378] [10.1021/acs.jmedchem.0c00502]

Source