The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5281610
Max Phase: Preclinical
Molecular Formula: C22H25Cl2N3O2S
Molecular Weight: 466.43
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc3c(c2)[C@H]2C[C@@H]3CCN2S(=O)(=O)c2cc(Cl)cc(Cl)c2)CC1
Standard InChI: InChI=1S/C22H25Cl2N3O2S/c1-25-6-8-26(9-7-25)18-2-3-20-15-4-5-27(22(10-15)21(20)14-18)30(28,29)19-12-16(23)11-17(24)13-19/h2-3,11-15,22H,4-10H2,1H3/t15-,22+/m0/s1
Standard InChI Key: JFHPNLALJKIFQH-OYHNWAKOSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-1.6479 -0.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9333 0.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9316 -1.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6479 -1.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7739 -0.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2215 -1.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2215 -0.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5366 -0.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9049 0.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6170 -0.3960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0939 -0.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7286 -1.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0296 0.3186 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8548 0.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2676 1.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0903 1.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5031 0.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0939 -0.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2692 -0.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3626 0.0328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0772 -0.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7918 0.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7918 0.8579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0772 1.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3626 0.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5065 1.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5029 1.7470 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.5065 -1.1089 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3150 0.7312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2432 1.1157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1240 0.4856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7739 -1.7470 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 4 1 0
4 3 2 0
5 6 1 0
6 3 1 0
6 7 2 0
7 2 1 0
7 8 1 0
5 9 1 0
8 9 1 0
8 10 1 0
10 11 1 0
5 12 1 0
12 11 1 0
10 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
1 20 1 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
20 25 1 0
23 26 1 0
16 27 1 0
18 28 1 0
13 29 2 0
13 30 2 0
8 31 1 6
5 32 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.43Molecular Weight (Monoisotopic): 465.1045AlogP: 4.37#Rotatable Bonds: 3Polar Surface Area: 43.86Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.89CX LogP: 4.27CX LogD: 3.66Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -0.96
References 1. Turnaturi R, Montenegro L, Marrazzo A, Parenti R, Pasquinucci L, Parenti C.. (2018) Benzomorphan skeleton, a versatile scaffold for different targets: A comprehensive review., 155 [PMID:29908442 ] [10.1016/j.ejmech.2018.06.017 ]