The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-carboxamido)propyl)picolinamide ID: ALA5281651
Max Phase: Preclinical
Molecular Formula: C19H22N8O5
Molecular Weight: 442.44
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)NCCCNC(=O)c2ccccn2)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C19H22N8O5/c20-15-11-16(25-8-24-15)27(9-26-11)19-13(29)12(28)14(32-19)18(31)23-7-3-6-22-17(30)10-4-1-2-5-21-10/h1-2,4-5,8-9,12-14,19,28-29H,3,6-7H2,(H,22,30)(H,23,31)(H2,20,24,25)/t12-,13+,14-,19+/m0/s1
Standard InChI Key: LILMNYQDQBNGCW-SSHHRWTQSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.9156 -0.6025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5930 -0.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4459 -1.2808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5913 -1.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2728 -0.4277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9207 -1.9269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2542 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9726 -0.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9771 -1.6552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2534 -2.8285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6666 0.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9136 0.3838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9093 1.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6597 1.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1275 0.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2673 1.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8998 2.1754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9179 0.7899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5471 1.3098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3457 2.4216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0947 1.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8149 1.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4568 1.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1770 1.5811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8190 2.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5392 1.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7407 2.8285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6148 0.9290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3342 0.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9771 1.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8958 1.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1762 2.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 2 0
2 5 1 0
3 6 2 0
4 6 1 0
4 7 1 0
5 8 2 0
7 9 2 0
8 9 1 0
7 10 1 0
11 1 1 1
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
13 16 1 1
14 17 1 6
15 18 1 6
16 19 1 0
16 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.44Molecular Weight (Monoisotopic): 442.1713AlogP: -1.64#Rotatable Bonds: 7Polar Surface Area: 190.40Molecular Species: NEUTRALHBA: 11HBD: 5#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.39CX Basic pKa: 4.92CX LogP: -2.25CX LogD: -2.25Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -0.11