N-(3-((2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-carboxamido)propyl)picolinamide

ID: ALA5281651

Max Phase: Preclinical

Molecular Formula: C19H22N8O5

Molecular Weight: 442.44

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)NCCCNC(=O)c2ccccn2)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C19H22N8O5/c20-15-11-16(25-8-24-15)27(9-26-11)19-13(29)12(28)14(32-19)18(31)23-7-3-6-22-17(30)10-4-1-2-5-21-10/h1-2,4-5,8-9,12-14,19,28-29H,3,6-7H2,(H,22,30)(H,23,31)(H2,20,24,25)/t12-,13+,14-,19+/m0/s1

Standard InChI Key:  LILMNYQDQBNGCW-SSHHRWTQSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -2.9156   -0.6025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5930   -0.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4459   -1.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5913   -1.6886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2728   -0.4277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9207   -1.9269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2542   -2.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9726   -0.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9771   -1.6552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2534   -2.8285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6666    0.1436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9136    0.3838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9093    1.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6597    1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1275    0.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2673    1.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8998    2.1754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9179    0.7899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5471    1.3098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3457    2.4216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0947    1.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8149    1.4454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4568    1.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1770    1.5811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8190    2.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5392    1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7407    2.8285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6148    0.9290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3342    0.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9771    1.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8958    1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1762    2.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  2  5  1  0
  3  6  2  0
  4  6  1  0
  4  7  1  0
  5  8  2  0
  7  9  2  0
  8  9  1  0
  7 10  1  0
 11  1  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 13 16  1  1
 14 17  1  6
 15 18  1  6
 16 19  1  0
 16 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281651

    ---

Associated Targets(Human)

METTL3 Tbio N6-adenosine-methyltransferase catalytic subunit (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.44Molecular Weight (Monoisotopic): 442.1713AlogP: -1.64#Rotatable Bonds: 7
Polar Surface Area: 190.40Molecular Species: NEUTRALHBA: 11HBD: 5
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.39CX Basic pKa: 4.92CX LogP: -2.25CX LogD: -2.25
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: -0.11

References

1. Xu P, Ge R..  (2022)  Roles and drug development of METTL3 (methyltransferase-like 3) in anti-tumor therapy.,  230  [PMID:35063732] [10.1016/j.ejmech.2022.114118]

Source