The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-(3-(furan-2-yl)-1H-pyrazol-5-yl)(3-(5-(trifluoromethyl)-1H-benzo[d][1,2,3]triazol-1-yl)piperidin-1-yl)methanone ID: ALA5281676
Max Phase: Preclinical
Molecular Formula: C20H17F3N6O2
Molecular Weight: 430.39
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cc(-c2ccco2)n[nH]1)N1CCC[C@H](n2nnc3cc(C(F)(F)F)ccc32)C1
Standard InChI: InChI=1S/C20H17F3N6O2/c21-20(22,23)12-5-6-17-14(9-12)26-27-29(17)13-3-1-7-28(11-13)19(30)16-10-15(24-25-16)18-4-2-8-31-18/h2,4-6,8-10,13H,1,3,7,11H2,(H,24,25)/t13-/m0/s1
Standard InChI Key: VWWFNJBXTDFVAJ-ZDUSSCGKSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-3.7263 0.4331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9275 0.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3515 0.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5721 -0.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3664 -0.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9477 -0.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6154 0.4185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5470 1.3685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7361 1.2320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7440 -0.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3206 0.0155 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.3318 -1.1487 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.5392 -1.3685 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.9065 0.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1907 0.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5180 -0.0112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5108 -0.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2050 -1.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9137 -0.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2304 0.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2304 1.2225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9427 -0.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6938 0.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2440 -0.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8329 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0287 -0.8290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0666 -0.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5499 0.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3318 0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3318 -0.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5499 -0.9531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
2 8 1 0
8 9 2 0
9 7 1 0
6 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
14 7 1 6
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
19 18 1 0
14 19 1 0
16 20 1 0
20 21 2 0
20 22 1 0
23 22 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 22 1 0
24 27 1 0
28 27 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.39Molecular Weight (Monoisotopic): 430.1365AlogP: 3.91#Rotatable Bonds: 3Polar Surface Area: 92.84Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.46CX Basic pKa: 0.68CX LogP: 3.19CX LogD: 3.19Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -2.37
References 1. Willems HMG, Edwards S, Boffey HK, Chawner SJ, Green C, Romero T, Winpenny D, Skidmore J, Clarke JH, Andrews SP.. (2023) Identification of ARUK2002821 as an isoform-selective PI5P4Kα inhibitor., 14 (5): [PMID:37252102 ] [10.1039/d3md00039g ]