(S)-(3-(furan-2-yl)-1H-pyrazol-5-yl)(3-(5-(trifluoromethyl)-1H-benzo[d][1,2,3]triazol-1-yl)piperidin-1-yl)methanone

ID: ALA5281676

Max Phase: Preclinical

Molecular Formula: C20H17F3N6O2

Molecular Weight: 430.39

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1cc(-c2ccco2)n[nH]1)N1CCC[C@H](n2nnc3cc(C(F)(F)F)ccc32)C1

Standard InChI:  InChI=1S/C20H17F3N6O2/c21-20(22,23)12-5-6-17-14(9-12)26-27-29(17)13-3-1-7-28(11-13)19(30)16-10-15(24-25-16)18-4-2-8-31-18/h2,4-6,8-10,13H,1,3,7,11H2,(H,24,25)/t13-/m0/s1

Standard InChI Key:  VWWFNJBXTDFVAJ-ZDUSSCGKSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -3.7263    0.4331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9275    0.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3515    0.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5721   -0.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3664   -0.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9477   -0.3652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6154    0.4185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5470    1.3685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7361    1.2320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7440   -0.5711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3206    0.0155    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3318   -1.1487    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5392   -1.3685    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9065    0.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1907    0.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5180   -0.0112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5108   -0.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2050   -1.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9137   -0.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2304    0.3998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2304    1.2225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9427   -0.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6938    0.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2440   -0.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8329   -1.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0287   -0.8290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0666   -0.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5499    0.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3318    0.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3318   -0.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5499   -0.9531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  2  8  1  0
  8  9  2  0
  9  7  1  0
  6 10  1  0
 10 11  1  0
 10 12  1  0
 10 13  1  0
 14  7  1  6
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 14 19  1  0
 16 20  1  0
 20 21  2  0
 20 22  1  0
 23 22  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  1  0
 24 27  1  0
 28 27  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281676

    ---

Associated Targets(Human)

PIP4K2A Tbio Phosphatidylinositol-5-phosphate 4-kinase type-2 alpha (1501 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.39Molecular Weight (Monoisotopic): 430.1365AlogP: 3.91#Rotatable Bonds: 3
Polar Surface Area: 92.84Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.46CX Basic pKa: 0.68CX LogP: 3.19CX LogD: 3.19
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -2.37

References

1. Willems HMG, Edwards S, Boffey HK, Chawner SJ, Green C, Romero T, Winpenny D, Skidmore J, Clarke JH, Andrews SP..  (2023)  Identification of ARUK2002821 as an isoform-selective PI5P4Kα inhibitor.,  14  (5): [PMID:37252102] [10.1039/d3md00039g]

Source