The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-amino-7-(4-bromophenyl)-8,9-dihydro-6H,7H-chromeno[3',4':5,6]pyrano[2,3-d]pyrimidin-6-one ID: ALA5281677
Max Phase: Preclinical
Molecular Formula: C20H14BrN3O3
Molecular Weight: 424.25
Associated Items:
Names and Identifiers Canonical SMILES: NC1NC=NC2=C1C(c1ccc(Br)cc1)c1c(c3ccccc3oc1=O)O2
Standard InChI: InChI=1S/C20H14BrN3O3/c21-11-7-5-10(6-8-11)14-15-17(27-19-16(14)18(22)23-9-24-19)12-3-1-2-4-13(12)26-20(15)25/h1-9,14,18H,22H2,(H,23,24)
Standard InChI Key: YJVGAFBGULKMPT-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 31 0 0 0 0 0 0 0 0999 V2000
-1.0745 0.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0745 -0.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3529 -0.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3543 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3543 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3719 0.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3719 1.6540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3353 2.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0712 1.6705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0712 0.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7858 0.4247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0690 -0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0690 -1.6538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7856 -2.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4960 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4960 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7839 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2107 -2.0628 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-0.3529 -1.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0650 -2.0706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7818 -1.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7818 -0.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5034 -0.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2107 -0.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2107 -1.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4939 -2.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3638 -2.0624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 1 0
6 5 2 0
6 1 1 0
6 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
5 10 1 0
10 11 1 0
12 4 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
15 18 1 0
19 3 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 2 1 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
27 19 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.25Molecular Weight (Monoisotopic): 423.0219AlogP: 3.21#Rotatable Bonds: 1Polar Surface Area: 89.85Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.56CX LogP: 2.48CX LogD: 2.09Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: 0.13
References 1. Salehian F, Nadri H, Jalili-Baleh L, Youseftabar-Miri L, Abbas Bukhari SN, Foroumadi A, Tüylü Küçükkilinç T, Sharifzadeh M, Khoobi M.. (2021) A review: Biologically active 3,4-heterocycle-fused coumarins., 212 [PMID:33276991 ] [10.1016/j.ejmech.2020.113034 ]