The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 4-{[2-(4-bromophenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl}benzoate ID: ALA5281716
Max Phase: Preclinical
Molecular Formula: C22H22BrN3O5S
Molecular Weight: 520.41
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(S(=O)(=O)N2CCC3(CC2)N=C(c2ccc(Br)cc2)C(=O)N3)cc1
Standard InChI: InChI=1S/C22H22BrN3O5S/c1-2-31-21(28)16-5-9-18(10-6-16)32(29,30)26-13-11-22(12-14-26)24-19(20(27)25-22)15-3-7-17(23)8-4-15/h3-10H,2,11-14H2,1H3,(H,25,27)
Standard InChI Key: ODJBFBRQPGMUFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.2459 -0.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5314 -0.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8169 -0.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8169 -1.7234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5314 -2.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2459 -1.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1027 -2.1357 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.6114 -1.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9601 -1.3107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5785 -0.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2479 -0.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4243 -0.0978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.3751 -0.9532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6603 0.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4851 0.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8955 1.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4831 2.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6624 2.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2462 1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6117 -0.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3241 -0.4881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0385 -0.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0402 -1.7212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3287 -2.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8954 2.8499 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-0.5151 -2.8499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4803 -2.7189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7528 -0.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7528 0.3364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4670 -0.9006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1813 -0.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8955 -0.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
4 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
10 11 1 0
12 11 2 0
1 12 1 0
10 13 2 0
14 11 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
14 19 1 0
19 18 2 0
20 8 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
8 24 1 0
17 25 1 0
7 26 2 0
7 27 2 0
22 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.41Molecular Weight (Monoisotopic): 519.0464AlogP: 2.73#Rotatable Bonds: 5Polar Surface Area: 105.14Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.65CX Basic pKa: ┄CX LogP: 3.89CX LogD: 3.88Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.10
References 1. Bhuiyan AI, Choi AH, Ghoshal S, Adiele UA, Dana D, Choi JY, Fath KR, Talele TT, Pathak SK.. (2023) Identification of a novel spirocyclic Nek2 inhibitor using high throughput virtual screening., 88 [PMID:37094724 ] [10.1016/j.bmcl.2023.129288 ]