The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5281719
Max Phase: Preclinical
Molecular Formula: C18H18FN5O2
Molecular Weight: 355.37
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)COc2ccc(F)cc2CNc2ccc3ncc(n3n2)C(=O)N1
Standard InChI: InChI=1S/C18H18FN5O2/c1-18(2)10-26-14-4-3-12(19)7-11(14)8-20-15-5-6-16-21-9-13(17(25)22-18)24(16)23-15/h3-7,9H,8,10H2,1-2H3,(H,20,23)(H,22,25)
Standard InChI Key: UQCBXWVFQJXMFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 29 0 0 0 0 0 0 0 0999 V2000
-2.4331 2.9271 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7171 2.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7171 1.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9978 1.2827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2820 -0.2486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8667 -0.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0417 -0.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3735 -1.6709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0255 -2.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6716 -2.9326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4151 -2.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1676 -1.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6081 -0.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1928 -0.2389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6025 0.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1872 1.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3622 1.1899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2850 1.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2850 2.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0043 2.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4331 -0.9517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8610 -2.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2763 -1.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3184 0.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3184 0.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8723 0.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
6 5 1 0
7 6 2 0
8 7 1 0
9 8 1 0
9 10 2 0
11 10 1 0
12 11 2 0
8 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
4 18 2 0
18 19 1 0
19 20 2 0
20 2 1 0
13 21 2 0
22 9 1 0
23 22 2 0
6 23 1 0
15 24 1 0
15 25 1 0
5 26 1 0
26 4 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 355.37Molecular Weight (Monoisotopic): 355.1445AlogP: 2.38#Rotatable Bonds: ┄Polar Surface Area: 80.55Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.56CX LogP: 1.95CX LogD: 1.95Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: -0.85
References 1. Xiao X, Xu Y, Yu X, Chen Y, Zhao W, Xie Z, Zhu X, Xu H, Yang Y, Zhang P.. (2023) Discovery of imidazo[1,2-b]pyridazine macrocyclic derivatives as novel ALK inhibitors capable of combating multiple resistant mutants., 89 [PMID:37127101 ] [10.1016/j.bmcl.2023.129309 ]