N-(4-(3,5-dimethoxystyryl)phenyl)-2-((5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl)thio)acetamide

ID: ALA5281721

Max Phase: Preclinical

Molecular Formula: C26H22FN3O4S

Molecular Weight: 491.54

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/c2ccc(NC(=O)CSc3nnc(-c4ccccc4F)o3)cc2)cc(OC)c1

Standard InChI:  InChI=1S/C26H22FN3O4S/c1-32-20-13-18(14-21(15-20)33-2)8-7-17-9-11-19(12-10-17)28-24(31)16-35-26-30-29-25(34-26)22-5-3-4-6-23(22)27/h3-15H,16H2,1-2H3,(H,28,31)/b8-7+

Standard InChI Key:  MHRSZBRXAOSVDH-BQYQJAHWSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -5.8178   -0.0832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1032    0.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3913   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3913   -0.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1015   -1.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8178   -0.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5324    0.3293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5324    1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1015   -2.1450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3868   -2.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6767    0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9621   -0.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2474    0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2472    1.1550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5343    1.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8194    1.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8179    0.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5297   -0.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1049    1.5655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6097    1.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3244    1.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6097    0.3277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0389    1.1530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7536    1.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8398    2.3858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6466    2.5573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0590    1.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5070    1.2301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8842    1.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2970    2.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1197    2.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5324    1.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1233    1.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2986    1.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8860    0.4106    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  7  8  1  0
  5  9  1  0
  9 10  1  0
  3 11  1  0
 11 12  2  0
 12 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 25 24  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
 27 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5281721

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PANC-1 (6144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.54Molecular Weight (Monoisotopic): 491.1315AlogP: 5.79#Rotatable Bonds: 9
Polar Surface Area: 86.48Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.68CX Basic pKa: CX LogP: 5.06CX LogD: 5.06
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -1.61

References

1. Ahmadi R, Ebrahimzadeh MA..  (2020)  Resveratrol - A comprehensive review of recent advances in anticancer drug design and development.,  200  [PMID:32485531] [10.1016/j.ejmech.2020.112356]

Source