The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(3,5-dimethoxystyryl)phenyl)-2-((5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl)thio)acetamide ID: ALA5281721
Max Phase: Preclinical
Molecular Formula: C26H22FN3O4S
Molecular Weight: 491.54
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/c2ccc(NC(=O)CSc3nnc(-c4ccccc4F)o3)cc2)cc(OC)c1
Standard InChI: InChI=1S/C26H22FN3O4S/c1-32-20-13-18(14-21(15-20)33-2)8-7-17-9-11-19(12-10-17)28-24(31)16-35-26-30-29-25(34-26)22-5-3-4-6-23(22)27/h3-15H,16H2,1-2H3,(H,28,31)/b8-7+
Standard InChI Key: MHRSZBRXAOSVDH-BQYQJAHWSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-5.8178 -0.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1032 0.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3913 -0.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3913 -0.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1015 -1.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8178 -0.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5324 0.3293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5324 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1015 -2.1450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3868 -2.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6767 0.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9621 -0.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2474 0.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2472 1.1550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5343 1.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8194 1.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8179 0.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5297 -0.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1049 1.5655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6097 1.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3244 1.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6097 0.3277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0389 1.1530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7536 1.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8398 2.3858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6466 2.5573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0590 1.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5070 1.2301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8842 1.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2970 2.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1197 2.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5324 1.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1233 1.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2986 1.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8860 0.4106 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
3 11 1 0
11 12 2 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
25 24 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
27 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.54Molecular Weight (Monoisotopic): 491.1315AlogP: 5.79#Rotatable Bonds: 9Polar Surface Area: 86.48Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.68CX Basic pKa: ┄CX LogP: 5.06CX LogD: 5.06Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.23Np Likeness Score: -1.61
References 1. Ahmadi R, Ebrahimzadeh MA.. (2020) Resveratrol - A comprehensive review of recent advances in anticancer drug design and development., 200 [PMID:32485531 ] [10.1016/j.ejmech.2020.112356 ]