The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4,5-dichloro-1H-pyrrole-2-carboxamido)-3-isobutoxybenzamido)acetic acid ID: ALA5281739
Max Phase: Preclinical
Molecular Formula: C18H19Cl2N3O5
Molecular Weight: 428.27
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)COc1cc(C(=O)NCC(=O)O)ccc1NC(=O)c1cc(Cl)c(Cl)[nH]1
Standard InChI: InChI=1S/C18H19Cl2N3O5/c1-9(2)8-28-14-5-10(17(26)21-7-15(24)25)3-4-12(14)23-18(27)13-6-11(19)16(20)22-13/h3-6,9,22H,7-8H2,1-2H3,(H,21,26)(H,23,27)(H,24,25)
Standard InChI Key: ZBPICFMFEFJSDY-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
-0.3625 1.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3520 1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0639 1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0639 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3538 0.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3625 0.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0771 -0.0040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3538 -0.8248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0684 -1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0684 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7831 -2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3538 -2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7918 0.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5064 -0.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7918 1.2336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5926 -0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3994 -0.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8118 -0.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2599 0.3314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6370 -0.2815 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.8120 -1.7105 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.7785 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7785 2.4751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4931 1.2373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2078 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9224 1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6370 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9224 0.4122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
7 13 1 0
13 14 1 0
13 15 2 0
16 14 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 14 1 0
18 20 1 0
17 21 1 0
3 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.27Molecular Weight (Monoisotopic): 427.0702AlogP: 3.42#Rotatable Bonds: 8Polar Surface Area: 120.52Molecular Species: ACIDHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.15CX Basic pKa: ┄CX LogP: 2.63CX LogD: -0.84Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: -1.10