The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(5-(5-((2-hydroxy-2-phenylethyl)amino)pyridin-3-yl)-1H-indazol-3-yl)benzamide ID: ALA5281785
Max Phase: Preclinical
Molecular Formula: C27H23N5O2
Molecular Weight: 449.51
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1n[nH]c2ccc(-c3cncc(NC[C@H](O)c4ccccc4)c3)cc12)c1ccccc1
Standard InChI: InChI=1S/C27H23N5O2/c33-25(18-7-3-1-4-8-18)17-29-22-13-21(15-28-16-22)20-11-12-24-23(14-20)26(32-31-24)30-27(34)19-9-5-2-6-10-19/h1-16,25,29,33H,17H2,(H2,30,31,32,34)/t25-/m0/s1
Standard InChI Key: OSTSMXLBOZDZHJ-VWLOTQADSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.7086 2.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9940 2.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2822 2.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2822 1.4513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9923 1.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7086 1.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4965 1.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9834 1.8619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4965 2.5321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7109 0.3915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5110 0.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7253 -0.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1397 -1.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3542 -2.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1545 -2.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7384 -1.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5288 -0.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0966 0.7628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4351 1.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1525 1.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8672 1.0375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8672 0.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1543 -0.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4351 0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1543 -1.0326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8716 -1.4467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 -1.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 -0.2044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3062 -1.4467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0236 -1.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7384 -1.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7384 -2.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0255 -2.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3062 -2.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
7 10 1 0
10 11 1 0
11 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
11 18 2 0
19 4 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 6
27 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.51Molecular Weight (Monoisotopic): 449.1852AlogP: 5.02#Rotatable Bonds: 7Polar Surface Area: 102.93Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.07CX Basic pKa: 5.02CX LogP: 3.98CX LogD: 3.98Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.08
References 1. Yang B, Zhang H, Li N, Gao L, Jiang H, Kan W, Yuan H, Li J, Zhao D, Xiong B, Zhou Y, Guo D, Liu T.. (2022) Discovery of Novel N -(5-(Pyridin-3-yl)-1H -indazol-3-yl)benzamide Derivatives as Potent Cyclin-Dependent Kinase 7 Inhibitors for the Treatment of Autosomal Dominant Polycystic Kidney Disease., 65 (23.0): [PMID:36384292 ] [10.1021/acs.jmedchem.2c01334 ]