The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,2'S)-(ethane-1,2-diylbis(azanediyl))bis(butane-2,1-diyl) bis(2-methylpropanoate)Dihydrochloride ID: ALA5281822
Max Phase: Preclinical
Molecular Formula: C18H38Cl2N2O4
Molecular Weight: 344.50
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H](COC(=O)C(C)C)NCCN[C@@H](CC)COC(=O)C(C)C.Cl.Cl
Standard InChI: InChI=1S/C18H36N2O4.2ClH/c1-7-15(11-23-17(21)13(3)4)19-9-10-20-16(8-2)12-24-18(22)14(5)6;;/h13-16,19-20H,7-12H2,1-6H3;2*1H/t15-,16-;;/m0../s1
Standard InChI Key: VRWRJSZNPNLNNV-SXBSVMRRSA-N
Molfile:
RDKit 2D
26 23 0 0 0 0 0 0 0 0999 V2000
2.9356 1.8752 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.5726 0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8581 -0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8583 1.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8583 2.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5729 2.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1437 3.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4290 2.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4290 -0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7145 0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1437 -1.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1437 -2.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8584 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5729 -2.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8584 -3.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 -2.6817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1437 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8584 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0027 2.3663 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
3 4 1 0
4 5 1 1
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
9 11 1 0
4 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 1
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
19 23 2 0
16 24 1 0
24 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 344.50Molecular Weight (Monoisotopic): 344.2675AlogP: 2.12#Rotatable Bonds: 13Polar Surface Area: 76.66Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.08CX LogP: 3.31CX LogD: 1.60Aromatic Rings: ┄Heavy Atoms: 24QED Weighted: 0.39Np Likeness Score: 0.19
References 1. Larsen EM, Stephens DC, Clarke NH, Johnson RJ.. (2017) Ester-prodrugs of ethambutol control its antibacterial activity and provide rapid screening for mycobacterial hydrolase activity., 27 (19): [PMID:28882482 ] [10.1016/j.bmcl.2017.08.057 ]